FLUO 3 manufacturers
- Fluo-3
-
- $2.20
-
2026-08-25
- CAS:123632-39-3
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| Product Name: | FLUO 3 | | Synonyms: | 1-[2-AMINO-5-(2,7-DICHLORO-6-HYDROXY-3-OXO-3H-XANTHEN-9-YL)PHENOXY]-2-(2'-AMINO-5'-METHYLPHENOXY)ETHANE-N,N,N',N'-TETRAACETIC ACID PENTAAMMONIUM SALT;1-[2-AMINO-5-(2,7-DICHLORO-6-HYDROXY-3-OXO-3H-XANTHEN-9-YL)]-2-(2'-AMINO-5'-METHYLPHENOXY)ETHANE-N,N,N',N'-TETRAACETIC ACID, 5NH4;4-(2,7-DICHLORO-6-HYDROXY-3-OXO-9-XANTHENYL)-4'-METHYL-2,2'-(ETHYLENEDIOXY) DIANILINE-N,N,N',N'-TETRAACETIC ACID;FLUO 3, PENTAAMMONIUM SALT;FLUO 3;-(ethylenedioxy)dianiline-N;4-(2;-tetraacetic acid | | CAS: | 123632-39-3 | | MF: | C36H30Cl2N2O13 | | MW: | 769.53 | | EINECS: | | | Product Categories: | Xanthene | | Mol File: | 123632-39-3.mol |  |
| | FLUO 3 Chemical Properties |
| Melting point | >250℃ | | Boiling point | 1056.0±65.0 °C(Predicted) | | density | 1.66±0.1 g/cm3(Predicted) | | storage temp. | −20°C | | solubility | H2O: soluble | | form | powder | | pka | 1.66±0.10(Predicted) | | color | Dark reddish-brown | | Water Solubility | H2O: soluble | | λmax | 506nm | | Biological Applications | Calcium indicator; zinc indicator; identifying taste modulators; measuring membrane potential; treating defective skeletal muscle function during heart failure,pain | | InChIKey | OZLGRUXZXMRXGP-UHFFFAOYSA-N | | SMILES | Cc1ccc(N(CC(O)=O)CC(O)=O)c(OCCOc2cc(ccc2N(CC(O)=O)CC(O)=O)C3=C4C=C(Cl)C(=O)C=C4Oc5cc(O)c(Cl)cc35)c1 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | FLUO 3 Usage And Synthesis |
| Uses | Fluo-3 and related molecule Fluo3/AM are used as a fluorescence indicator of intracellular calcium (Ca2+). Fluo-3 may be use for flow cytometry and confocal laser scanning microscopy using visible light excitation (compatible with argon laser sources operating at 488 nm). Fluorescence intensity increases about 40-fold after calcium binding. | | Definition | ChEBI: Fluo-3 is a xanthene dye. It has a role as a fluorochrome. |
| | FLUO 3 Preparation Products And Raw materials |
|