- Fluo-3AM
-
- $2.20
-
2026-08-25
- CAS:121714-22-5
- Min. Order: 1kg
- Purity: 99%min
- Supply Ability: 100kg
|
| | Fluo 3-AM Basic information |
| Product Name: | Fluo 3-AM | | Synonyms: | 1-[2-AMINO-5-(2,7-DICHLORO-6-ACETOMETHOXY-3-OXO-3H-XANTHEN-9-YL)PHENOXY]-2-(2'-AMINO-5'-METHYLPHENOXY)ETHANE-N,N,N',N'TETRAACETIC ACID PENTAACETOXY-METHYL ESTER;1-[2-AMINO-5-(2,7-DICHLORO-6-HYDROXY-3-OXO-3H-XANTHEN-9-YL)]-2-(2'-AMINO-5' METHYLPHENOXY)ETHANE-N,N,N',N'-TETRAACETIC ACID PENTAACETOXYMETHYL ESTER;FLUO 3-AM;4-(6-Acetoxymethoxy-2,7-dichloro-3-oxo-9-xanthenyl)-4'-methyl-2,2′(ethylenedioxy)dianiline-N,N,N′,N'-tetraacetic acid tetrakis(acetoxymethyl) ester;4-(6-ACETOXYMETHOXY-2,7-DICHLORO-3-OXO-9-XANTHENYL)-4'-METHYL-2,2'(ETHYLENEDIOXY)DIANILINE-N,N,N',N'-TETRAACETIC ACID TETRAKIS(ACETOXYMETHYL) ESTER;FLUO-3, AM;FLUO 3/AM (1SET = 10x100UG);FLUO 3-AM, FOR FLUORESCENCE | | CAS: | 121714-22-5 | | MF: | C51H50Cl2N2O23 | | MW: | 1129.85 | | EINECS: | | | Product Categories: | Xanthene | | Mol File: | 121714-22-5.mol |  |
| | Fluo 3-AM Chemical Properties |
| Melting point | >250℃ | | Boiling point | 1090.9±65.0 °C(Predicted) | | density | 1.49±0.1 g/cm3(Predicted) | | Fp | 87℃ | | storage temp. | −20°C | | solubility | DMSO: soluble | | form | crystals | | pka | 1.92±0.50(Predicted) | | color | Dark red | | λmax | 464nm | | Biological Applications | Calcium indicator; detecting leukocyte tumor cells; identifying taste modulators; treating pain | | InChIKey | PTPUOMXKXCCSEN-UHFFFAOYSA-N | | SMILES | C(OCOC(C)=O)(=O)CN(C1=CC=C(C2C3=C(C=C(OCOC(C)=O)C(Cl)=C3)OC3C=2C=C(Cl)C(=O)C=3)C=C1OCCOC1=CC(C)=CC=C1N(CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O)CC(OCOC(C)=O)=O | | CAS DataBase Reference | 121714-22-5(CAS DataBase Reference) |
| Safety Statements | 22-24/25 | | RIDADR | NA 1993 / PGIII | | WGK Germany | 3 | | F | 1-8-10 | | HS Code | 29329990 | | Storage Class | 10 - Combustible liquids |
| | Fluo 3-AM Usage And Synthesis |
| Description | Fluo-3 is a visable wavelength calcium indicator commonly used in flow cytometry (FC) and cell-based experiments to detect changes in intracellular calcium levels. Fluo-3 AM is cell-permeable and can be cleaved to release fluo-3 in cells. | | Chemical Properties | Fluo 3-AM is red solid, | | Uses | apoptosis probe | | Uses | Fluo 3-AM is used with visible-light excitation sources in flow cytometry and confocal laser-scanning microscopy. | | Uses | FLUO 3/AM is a visible wavelength calcium probe capable of indicating changes in Ca2+levels. | | Biological Activity | Primary Target
Ca2+ indicators | | Excitation / Emission Maximum | 488 nm/526 nm |
| | Fluo 3-AM Preparation Products And Raw materials |
|