| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
|
| | Ethyl 5-methylisoxazole-3-carboxylate Basic information |
| | Ethyl 5-methylisoxazole-3-carboxylate Chemical Properties |
| Melting point | 27-31 °C | | Boiling point | 77-79°C 0,5mm | | density | 1.139 | | Fp | 77-79°C/0.5mm | | storage temp. | 2-8°C | | form | solid | | pka | -5.08±0.50(Predicted) | | Appearance | White to off-white Solid | | Water Solubility | It is insoluble in water. | | InChI | InChI=1S/C7H9NO3/c1-3-10-7(9)6-4-5(2)11-8-6/h4H,3H2,1-2H3 | | InChIKey | OCCIGHIQVMLYBZ-UHFFFAOYSA-N | | SMILES | O1C(C)=CC(C(OCC)=O)=N1 | | CAS DataBase Reference | 3209-72-1(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids |
| Provider | Language |
|
ALFA
| English |
| | Ethyl 5-methylisoxazole-3-carboxylate Usage And Synthesis |
| Chemical Properties | Low melting solid or Liquid | | Uses | Ethyl 5-methylisoxazole-3-carboxylate, It is an important raw material and intermediate used in Organic Synthesis, Pharmaceuticals, Agrochemicals and Dyestuff. |
| | Ethyl 5-methylisoxazole-3-carboxylate Preparation Products And Raw materials |
|