|
|
| | Bupropion morpholinol Basic information |
| | Bupropion morpholinol Chemical Properties |
| Melting point | 121-123°C | | Boiling point | 386.6±42.0 °C(Predicted) | | density | 1.144±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer | | solubility | DMF: 20 mg/ml; DMSO: 20 mg/ml; Ethanol: 20 mg/ml; Ethanol:PBS(pH 7.2) (1:1): 0.50 mg/ml | | form | A crystalline solid | | pka | 11.90±0.60(Predicted) | | color | White to off-white | | InChI | InChI=1S/C13H18ClNO2/c1-9-13(16,17-8-12(2,3)15-9)10-5-4-6-11(14)7-10/h4-7,9,15-16H,8H2,1-3H3 | | InChIKey | RCOBKSKAZMVBHT-UHFFFAOYSA-N | | SMILES | N1C(C)(C)COC(C2=CC=CC(Cl)=C2)(O)C1C |
| | Bupropion morpholinol Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | A metabolite of Bupropion, an antidepressant. The compound exists mainly as cyclic acetal (2-hydroxy-2-(3’-chlorophenyl)-355-trimethylmorpholine). See US Pat. # 634.2496 |
| | Bupropion morpholinol Preparation Products And Raw materials |
|