|
|
| | 1-(3-Chlorophenyl)-2-hydroxy-1-propanone Basic information |
| Product Name: | 1-(3-Chlorophenyl)-2-hydroxy-1-propanone | | Synonyms: | Bupropion IMpurity-C(USP);Bupropion EP Impurity C;1-(3-Chlorophenyl)-2-hydroxy-1-propanone;Bupropion Hydrochloride Related Compound C (40 mg) (1-(3-chlorophenyl)-2-hydroxy-1-propanone) (COLD SHIPMENT REQUIRED);Bupropion USP RC C;Bupropion Impurity C;Bupropion Impurity 3/Bupropion USP RC C/1-(3-Chlorophenyl)-2-hydroxy-1-propanone;(+/-)-1-(3-chlorophenyl)-2-hydroxypropan-1-one | | CAS: | 152943-33-4 | | MF: | C9H9ClO2 | | MW: | 184.62 | | EINECS: | | | Product Categories: | Aromatics;Impurities | | Mol File: | 152943-33-4.mol |  |
| | 1-(3-Chlorophenyl)-2-hydroxy-1-propanone Chemical Properties |
| Boiling point | 301.7±22.0 °C(Predicted) | | density | 1.253±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 12.71±0.20(Predicted) | | form | liquid | | color | Yellow | | Major Application | pharmaceutical (small molecule) | | InChI | InChI=1S/C9H9ClO2/c1-6(11)9(12)7-3-2-4-8(10)5-7/h2-6,11H,1H3 | | InChIKey | PRVHLTNNKRCHGO-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC(Cl)=C1)(=O)C(O)C |
| WGK Germany | WGK 3 | | Storage Class | 10 - Combustible liquids |
| | 1-(3-Chlorophenyl)-2-hydroxy-1-propanone Usage And Synthesis |
| Uses | Bupropion intermediate. Bupropion hydrochloride related impurity C. Bupropion USP Related Compound C. |
| | 1-(3-Chlorophenyl)-2-hydroxy-1-propanone Preparation Products And Raw materials |
|