| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 3-(2-Dimethylaminoethylamino)piperidine-1-carboxylic acid tert-butyl ester Basic information |
| Product Name: | 3-(2-Dimethylaminoethylamino)piperidine-1-carboxylic acid tert-butyl ester | | Synonyms: | TERT-BUTYL 3-(2-(DIMETHYLAMINO)ETHYLAMINO)PIPERIDINE-1-CARBOXYLATE;1-Boc-3-(2-dimethylaminoethylamino)piperidine;1-N-BOC-3-(2'-DIMETHYLAMINOETHYLAMINO)PIPERIDINE;1-Piperidinecarboxylic acid, 3-[[2-(dimethylamino)ethyl]amino]-, 1,1-dimethylethyl ester;3-(2-Dimethylaminoethylamino)piperidine-1-carboxylic acid tert-butyl ester | | CAS: | 887588-48-9 | | MF: | C14H29N3O2 | | MW: | 271.4 | | EINECS: | | | Product Categories: | | | Mol File: | 887588-48-9.mol |  |
| | 3-(2-Dimethylaminoethylamino)piperidine-1-carboxylic acid tert-butyl ester Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | 1S/C14H29N3O2/c1-14(2,3)19-13(18)17-9-6-7-12(11-17)15-8-10-16(4)5/h12,15H,6-11H2,1-5H3 | | InChIKey | JAPWWRPJNWOXFE-UHFFFAOYSA-N | | SMILES | CN(C)CCNC1CN(C(OC(C)(C)C)=O)CCC1 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 3-(2-Dimethylaminoethylamino)piperidine-1-carboxylic acid tert-butyl ester Usage And Synthesis |
| | 3-(2-Dimethylaminoethylamino)piperidine-1-carboxylic acid tert-butyl ester Preparation Products And Raw materials |
|