| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 8-(2-Aminoethylamino)-1-naphthalenesulfonic acid Basic information |
| | 8-(2-Aminoethylamino)-1-naphthalenesulfonic acid Chemical Properties |
| Melting point | 345-350°C dec. | | density | 1.432±0.06 g/cm3(Predicted) | | solubility | DMSO | | form | Powder | | pka | -0.54±0.40(Predicted) | | color | Off-White | | InChI | 1S/C12H14N2O3S/c13-7-8-14-10-5-1-3-9-4-2-6-11(12(9)10)18(15,16)17/h1-6,14H,7-8,13H2,(H,15,16,17) | | InChIKey | XCNDHKWVELDQPO-UHFFFAOYSA-N | | SMILES | NCCNc1cccc2cccc(c12)S(O)(=O)=O | | CAS DataBase Reference | 50402-57-8 |
| Hazard Codes | C,Xi | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| | 8-(2-Aminoethylamino)-1-naphthalenesulfonic acid Usage And Synthesis |
| Chemical Properties | Off-White Powder | | Uses | A fluorescent reagent with a terminal amine for derivatization |
| | 8-(2-Aminoethylamino)-1-naphthalenesulfonic acid Preparation Products And Raw materials |
|