| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Glutaryl-Ala-Ala-Phe 4-methoxy-beta-naphthylamide Basic information |
| | Glutaryl-Ala-Ala-Phe 4-methoxy-beta-naphthylamide Chemical Properties |
| Boiling point | 996.422±65.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.273±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | -20°C | | solubility | DMF: 50mg/mL, clear, colorless to faintly yellow | | form | powder | | pka | 4.640±0.10(predicted) | | InChIKey | QFJWKXYGBSQMDX-UHFFFAOYSA-N | | SMILES | COc1cc(NC(=O)C(Cc2ccccc2)NC(=O)C(C)NC(=O)C(C)NC(=O)CCCC(O)=O)cc3ccccc13 |
| Hazard Codes | Xn | | Risk Statements | 40 | | Safety Statements | 22-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Carc. 2 |
| | Glutaryl-Ala-Ala-Phe 4-methoxy-beta-naphthylamide Usage And Synthesis |
| Uses | A novel alkylamides of carboxyalkanoyl peptides which are capable of inhibiting elastase. |
| | Glutaryl-Ala-Ala-Phe 4-methoxy-beta-naphthylamide Preparation Products And Raw materials |
|