| Company Name: |
T&W GROUP |
| Tel: |
021-61551611 13296011611 |
| Email: |
contact@trustwe.com |
Benzoic acid, 2,4-dihydroxy-6-pentyl-, ethyl ester manufacturers
|
| | Benzoic acid, 2,4-dihydroxy-6-pentyl-, ethyl ester Basic information |
| Product Name: | Benzoic acid, 2,4-dihydroxy-6-pentyl-, ethyl ester | | Synonyms: | ethyl 2,4-dihydroxy-6-pentylbenzoate;2,4-dihydroxy-6-n-pentylbenzoic acid ethyl ester;ethyl 2,4-dihydroxy-6-pentylbenzoate(Ethyl olivetolate);2,4-Dihydroxy-6-pentyl-benzoesaeure-aethylester;Ethyl Olivetolate;Benzoic acid, 2,4-dihydroxy-6-pentyl-, ethyl ester | | CAS: | 38862-65-6 | | MF: | C14H20O4 | | MW: | 252.31 | | EINECS: | 857-569-0 | | Product Categories: | | | Mol File: | 38862-65-6.mol |  |
| | Benzoic acid, 2,4-dihydroxy-6-pentyl-, ethyl ester Chemical Properties |
| Melting point | 69 °C | | Boiling point | 420.4±30.0 °C(Predicted) | | density | 1.131±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 8.30±0.23(Predicted) | | color | White to Light Brown | | InChI | InChI=1S/C14H20O4/c1-3-5-6-7-10-8-11(15)9-12(16)13(10)14(17)18-4-2/h8-9,15-16H,3-7H2,1-2H3 | | InChIKey | ALCUWNWVZNZFHQ-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C1=C(CCCCC)C=C(O)C=C1O |
| | Benzoic acid, 2,4-dihydroxy-6-pentyl-, ethyl ester Usage And Synthesis |
| Uses | Ethyl Olivetolate is used for preparation of crystalline Cannabidiol for pharmaceutical formulations. |
| | Benzoic acid, 2,4-dihydroxy-6-pentyl-, ethyl ester Preparation Products And Raw materials |
|