|
|
| | 21-Dehydro Budesonide Basic information |
| Product Name: | 21-Dehydro Budesonide | | Synonyms: | 21-Dehydro Budesonide;(11β,16α)-16,17-[Butylidenebis(oxy)]-11-hydroxy-3,20-dioxopregna-1,4-dien-21-al;Budesonide IMpurity D;16α,17-[(1RS)-butylidenebis(oxy)]-11β-hydroxy-3,20-dioxopregna-1,4-dien-21-al;Budesonide Impurity 4(Budesonide EP Impurity D);Pregna-1,4-dien-21-al, 16,17-[butylidenebis(oxy)]-11-hydroxy-3,20-dioxo-, (11β,16α)-;2-((6aR,6bS,7S,8aS,8bS,11aR,12aS,12bS)-7-hydroxy-6a,8a-dimethyl-4-oxo-10-propyl-2,4,6a,6b,7,8,8a,8b,11a,12,12a,12b-dodecahydro-1H-naphtho[2',1':4,5]indeno[1,2-d][1,3]dioxol-8b-yl)-2-oxoacetaldehyde;"Budesonide impurity D" 21 dehydrogenated budesonide“ | | CAS: | 85234-63-5 | | MF: | C25H32O6 | | MW: | 428.52 | | EINECS: | | | Product Categories: | Impurities;Intermediates & Fine Chemicals;Metabolites & Impurities;Pharmaceuticals;Steroids | | Mol File: | 85234-63-5.mol |  |
| | 21-Dehydro Budesonide Chemical Properties |
| Melting point | >110oC (dec.) | | Boiling point | 572.5±50.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly) | | pka | 14.21±0.70(Predicted) | | form | Solid | | color | White to Light Yellow | | Stability: | Hygroscopic | | InChIKey | UHEOYIKQUMWUPY-YQTFDVHINA-N | | SMILES | C1[C@]2(C)[C@@H]3[C@@H](O)C[C@]4(C)[C@]5(OC(CCC)O[C@H]5CC4[C@@H]3CCC2=CC(=O)C=1)C(=O)C=O |&1:1,3,4,7,9,16,19,r| | | CAS DataBase Reference | 85234-63-5 |
| | 21-Dehydro Budesonide Usage And Synthesis |
| Chemical Properties | Pale Yellow Solid | | Uses | 21-Dehydro Budesonide (Budesonide EP Impurity D) is a Budesonide (B689490) impurity. | | Uses | Budesonide (B689490) impurity. |
| | 21-Dehydro Budesonide Preparation Products And Raw materials |
|