|
|
| | (16α)-16,17-[Butylidenebis(oxy)]-21-hydroxypregna-1,4-diene-3,11,20-trione Basic information |
| Product Name: | (16α)-16,17-[Butylidenebis(oxy)]-21-hydroxypregna-1,4-diene-3,11,20-trione | | Synonyms: | 11-Keto Budesonide;Budesonide IMpurity L (11-Keto Budesonide, Mixture of DiastereoMers);11-Keto Budesonide
(Mixture of DiastereoMers);16α,17-[(1RS)-butylidenebis(oxy)]-21-hydroxypregna-1,4-diene-3,11,20-trione;Budesonide Impurity 12(Budesonide EP Impurity L);Budesonide EP Impurity L (11-Keto Budesonide) (Mixture of Diastereomers);Budesonide iMpurit L;Budesonide EP Imp L | | CAS: | 216453-74-6 | | MF: | C25H32O6 | | MW: | 428.52 | | EINECS: | | | Product Categories: | Impurities, Pharmaceuticals, Intermediates & Fine Chemicals, Steroids | | Mol File: | 216453-74-6.mol | ![(16α)-16,17-[Butylidenebis(oxy)]-21-hydroxypregna-1,4-diene-3,11,20-trione Structure](CAS/20180808/GIF/216453-74-6.gif) |
| | (16α)-16,17-[Butylidenebis(oxy)]-21-hydroxypregna-1,4-diene-3,11,20-trione Chemical Properties |
| Melting point | >97°C (dec.) | | Boiling point | 601.7±55.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) | | pka | 12.83±0.10(Predicted) | | form | Solid | | color | White to Light Yellow | | Major Application | pharmaceutical (small molecule) | | InChIKey | NTERSHSWHLAIHV-ADKFLVHOSA-N | | SMILES | O1[C@@]2([C@H](OC1CCC)C[C@@H]3[C@@]2(CC(=O)[C@H]4[C@H]3CCC5=CC(=O)C=C[C@@]54C)C)C(=O)CO |
| WGK Germany | WGK 3 | | HS Code | 2937290000 | | Storage Class | 11 - Combustible Solids |
| | (16α)-16,17-[Butylidenebis(oxy)]-21-hydroxypregna-1,4-diene-3,11,20-trione Usage And Synthesis |
| Uses | 11-Keto Budesonide is an impurity of Budesonide (B689490), an antiinflammatory agent. | | Uses | 11-Keto Budesonide (Budesonide EP Impurity L) is an impurity of Budesonide (B689490), an antiinflammatory agent. |
| | (16α)-16,17-[Butylidenebis(oxy)]-21-hydroxypregna-1,4-diene-3,11,20-trione Preparation Products And Raw materials |
|