|
|
| | 3-Nitropropanol Basic information |
| Product Name: | 3-Nitropropanol | | Synonyms: | 3-nitro-1-propano;3-nitro-1-propanol;1-Propanol, 3-nitro-;3-NITROPROPANOL 98+%;3-Hydroxy-1-nitropropane;3-NITROPROPANOL FOR SYNTHESIS;1. 3-nitro-1-propanol;5,6-dibromocholestan-3-ol | | CAS: | 25182-84-7 | | MF: | C3H7NO3 | | MW: | 105.09 | | EINECS: | 246-716-9 | | Product Categories: | | | Mol File: | 25182-84-7.mol |  |
| | 3-Nitropropanol Chemical Properties |
| Melting point | -20°C (estimate) | | Boiling point | 240℃ | | density | 1.189 | | refractive index | 1.4381 (estimate) | | Fp | 116℃ | | storage temp. | Store below +30°C. | | pka | 8.40±0.29(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C3H7NO3/c5-3-1-2-4(6)7/h5H,1-3H2 | | InChIKey | YISPKQZWSIMXMX-UHFFFAOYSA-N | | SMILES | C(O)CC[N+]([O-])=O |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible, acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral | | Toxicity | LD50 orl-rat: 77 mg/kg TOLED5 19,171,1983 |
| | 3-Nitropropanol Usage And Synthesis |
| Definition | ChEBI: The nitro compound formed from propan-1-ol by nitration at C-3. | | Safety Profile | A poison by ingestion,intraperitoneal, and subcutaneous routes. When heated todecomposition it emits toxic vapors of NOx. |
| | 3-Nitropropanol Preparation Products And Raw materials |
|