| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,5-Dihydroxybenzonitrile Basic information |
| Product Name: | 3,5-Dihydroxybenzonitrile | | Synonyms: | AKOS BB-9154;Benzonitrile, 3,5-dihydroxy-;3,5-Dihydroxybenzonitrile 98%;3,5-dihydroxybenzenecarbonitrile;3,5-DIHYDROXYBENZONI;5-Cyanoresorcinol;alpha-Resorcylonitrile;2-hydroxy-6-methyl-3-[(E)-1-oxo-3-phenylprop-2-enyl]-1H-pyridin-4-one | | CAS: | 19179-36-3 | | MF: | C7H5NO2 | | MW: | 135.12 | | EINECS: | 242-859-6 | | Product Categories: | Aromatic Nitriles | | Mol File: | 19179-36-3.mol |  |
| | 3,5-Dihydroxybenzonitrile Chemical Properties |
| Melting point | 190-193°C | | Boiling point | 248.79°C (rough estimate) | | density | 1.3124 (rough estimate) | | refractive index | 1.5800 (estimate) | | storage temp. | Storage temp. 2-8°C | | Appearance | White to off-white Solid | | Water Solubility | Soluble in water. | | BRN | 6322491 | | InChI | InChI=1S/C7H5NO2/c8-4-5-1-6(9)3-7(10)2-5/h1-3,9-10H | | InChIKey | ABHOEQJNEOMTEK-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(O)=CC(O)=C1 | | CAS DataBase Reference | 19179-36-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 20/22-36/37/38 | | Safety Statements | 26-36/37/39 | | RIDADR | 3439 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 2926907090 |
| Provider | Language |
|
ALFA
| English |
| | 3,5-Dihydroxybenzonitrile Usage And Synthesis |
| Uses | 3,5-Dihydroxybenzonitrile is used in the preparation of 3-hydroxy-5-methoxybenzonitrile using potassium carbonate as a reagent. |
| | 3,5-Dihydroxybenzonitrile Preparation Products And Raw materials |
|