| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 3,4,5-Trimethoxybenzonitrile Basic information |
| Product Name: | 3,4,5-Trimethoxybenzonitrile | | Synonyms: | 3,4,5-Trimethoxybenzonitrile, 97+%;Benzonitrile, 3,4,5-trimethoxy-;3,4,5-Trimethoxybenzenecarbonitrile;3,4,5-TRIMETHOXYBENZONITRILE 98+%;3,4,5-Trimethoxybenz;5-TriMethoxybenzonitrile;3,4,5-TriMethoxybenzonitrile;3,4,5-trimethoxy-benzonitril | | CAS: | 1885-35-4 | | MF: | C10H11NO3 | | MW: | 193.2 | | EINECS: | 217-550-4 | | Product Categories: | C10 to C27;Cyanides/Nitriles;Nitrogen Compounds;Aromatic Nitriles | | Mol File: | 1885-35-4.mol |  |
| | 3,4,5-Trimethoxybenzonitrile Chemical Properties |
| Melting point | 91-94 °C (lit.) | | Boiling point | 180-185 °C/10 mmHg (lit.) | | density | 1.2307 (rough estimate) | | refractive index | 1.5300 (estimate) | | Fp | 180-185°C/10mm | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | color | White to Orange to Green | | BRN | 979686 | | InChI | InChI=1S/C10H11NO3/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-5H,1-3H3 | | InChIKey | OSBQUSPVORCDCU-UHFFFAOYSA-N | | SMILES | C(#N)C1=CC(OC)=C(OC)C(OC)=C1 | | CAS DataBase Reference | 1885-35-4(CAS DataBase Reference) | | NIST Chemistry Reference | Benzonitrile, 3,4,5-trimethoxy-(1885-35-4) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38-21/22 | | Safety Statements | 26-37/39-36/37 | | RIDADR | 3276 | | WGK Germany | 3 | | RTECS | DI4965000 | | Hazard Note | Irritant | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29269090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 3,4,5-Trimethoxybenzonitrile Usage And Synthesis |
| Chemical Properties | WHITE TO BEIGE POWDER |
| | 3,4,5-Trimethoxybenzonitrile Preparation Products And Raw materials |
|