| Company Name: |
Cool Pharm, Ltd |
| Tel: |
021-60455363 18019463053 |
| Email: |
sales@coolpharm.com |
|
| | Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid Basic information |
| Product Name: | Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid | | Synonyms: | L-Allothreonine, N-[(9H-fluoren-9-ylMethoxy)carbonyl]-3-Methyl-;(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-hydroxy-3-methylbutanoic acid;(S)-2-(Fmoc-amino)-3-hydroxy-3-methylbutanoic Acid;Fmoc-L-Val(β-OH)-OH;(S)-Fmoc-β-hydroxy-valine;Fmoc-dMeS-OH;N-FMOC-3-Methyl-L-allothreonine;(S)-N-Fmoc-β-Hydroxyvaline | | CAS: | 1217603-41-2 | | MF: | C20H21NO5 | | MW: | 355.38 | | EINECS: | | | Product Categories: | unnatural amino acids | | Mol File: | Mol File |  |
| | Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid Chemical Properties |
| Boiling point | 595.5±50.0 °C(Predicted) | | density | 1.300±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 3.50±0.10(Predicted) | | InChI | InChI=1S/C20H21NO5/c1-20(2,25)17(18(22)23)21-19(24)26-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16/h3-10,16-17,25H,11H2,1-2H3,(H,21,24)(H,22,23)/t17-/m1/s1 | | InChIKey | KIOMNBRJPAICIT-QGZVFWFLSA-N | | SMILES | C(O)(=O)[C@H]([C@@](C)(O)C)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| | Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid Usage And Synthesis |
| | Fmoc-(S)-2-amino-3-hydroxy-3-methylbutanoic acid Preparation Products And Raw materials |
|