| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
- 6FTA
-
-
2022-02-10
- CAS:3016-76-0
- Min. Order: 1KG
- Purity: 97.7%
- Supply Ability: 100 tons
|
| | 4,4'-(Hexafluoroisopropylidene)diphthalic acid Basic information |
| Product Name: | 4,4'-(Hexafluoroisopropylidene)diphthalic acid | | Synonyms: | 4,4'-(2,2,2-Trifluoro-1-(trifluoromethyl)ethylidene)bis(1,2-benzenedicarboxylic acid);ne]bis-;4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bisphthalic acid;4 4'-(HEXAFLUOROISOPROPYLIDENE)DIPHTHAL;4,4′-[2,2,2-Trifluor-1-(trifluormethyl)ethyliden]bisphthalsure;2,2-BIS(3'',4''-DICARBOXYPHENYL)HEXAFLUOROPROPANE;2,2-Bis(3,4-dicarboxyphenyl)-1,1,1,3,3,3-hexafluoropropane;4,4'-(1,1,1,3,3,3-Hexafluoropropane-2,2-diyl)diphthalic acid | | CAS: | 3016-76-0 | | MF: | C19H10F6O8 | | MW: | 480.27 | | EINECS: | 221-154-7 | | Product Categories: | | | Mol File: | 3016-76-0.mol |  |
| | 4,4'-(Hexafluoroisopropylidene)diphthalic acid Chemical Properties |
| Melting point | 240-241°C | | Boiling point | 572.3±50.0 °C(Predicted) | | density | 1.681±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 2.51±0.10(Predicted) | | InChI | InChI=1S/C19H10F6O8/c20-18(21,22)17(19(23,24)25,7-1-3-9(13(26)27)11(5-7)15(30)31)8-2-4-10(14(28)29)12(6-8)16(32)33/h1-6H,(H,26,27)(H,28,29)(H,30,31)(H,32,33) | | InChIKey | APXJLYIVOFARRM-UHFFFAOYSA-N | | SMILES | C(C1=CC=C(C(O)=O)C(C(O)=O)=C1)(C1=CC=C(C(O)=O)C(C(O)=O)=C1)(C(F)(F)F)C(F)(F)F | | EPA Substance Registry System | 1,2-Benzenedicarboxylic acid, 4,4'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- (3016-76-0) |
| | 4,4'-(Hexafluoroisopropylidene)diphthalic acid Usage And Synthesis |
| Chemical Properties | white powder |
| | 4,4'-(Hexafluoroisopropylidene)diphthalic acid Preparation Products And Raw materials |
|