|
|
| | cyclo (Arg-Gly-Asp-d-Phe-Glu) Basic information |
| | cyclo (Arg-Gly-Asp-d-Phe-Glu) Chemical Properties |
| density | 1.54±0.1 g/cm3(Predicted) | | form | Solid | | pka | 4.01±0.10(Predicted) | | color | White to off-white | | Sequence | Cyclo(Arg-Gly-Asp-{d-Phe}-Glu) | | InChIKey | LHYAAFPJZDQDLU-WHSWRCCXNA-N | | SMILES | C(C1C=CC=CC=1)[C@H]1NC([C@@H](NC(CNC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CCC(=O)O)NC1=O)=O)CC(=O)O)=O |&1:7,10,17,28,r| |
| | cyclo (Arg-Gly-Asp-d-Phe-Glu) Usage And Synthesis |
| Uses | Cyclo(Arg-Gly-Asp-(D-Phe)-Glu) (c(RGDfE)) is a cyclic RGD peptide that serves as a conjugated multifunctional nanodrug delivery system to target Gemcitabine to pancreatic cancer cells. Cyclo(Arg-Gly-Asp-(D-Phe)-Glu) can be used in cancer research[1]. | | References | [1] Sun J , et al. A c(RGDfE) conjugated multi-functional nanomedicine delivery system for targeted pancreatic cancer therapy. J Mater Chem B. 2015 Feb 14;3(6):1049-1058. DOI:10.1039/c4tb01402b |
| | cyclo (Arg-Gly-Asp-d-Phe-Glu) Preparation Products And Raw materials |
|