|
|
| Product Name: | DMBAP | | Synonyms: | DMBAP;N-(3,3-Dimethylbutyl)-L-alpha-aspartyl-L-phenylalanine;L-Phenylalanine, N-(3,3-dimethylbutyl)-L-α-aspartyl-;Neotame Related Compound A (15 mg);Neotame Impurity 1(Neotame Related Compound A);Neotame Related Compound A (N-[N-(3,3-dimethylbutyl)-L-alpha-aspartyl]-L-phenylalanine) (1460215);N-(3,3-Dimethylbutyl)-L-α-aspartyl-L-phenylalanine;(S)-4-(((S)-1-carboxy-2-phenylethyl)amino)-3-((3,3-dimethylbutyl)amino)-4-oxobutanoic acid | | CAS: | 190910-14-6 | | MF: | C19H28N2O5 | | MW: | 364.44 | | EINECS: | | | Product Categories: | Amino Acids & Derivatives, Aromatics, Intermediates | | Mol File: | 190910-14-6.mol |  |
| | DMBAP Chemical Properties |
| Melting point | 197 °C (decomp)(Solv: water (7732-18-5)) | | Boiling point | 605.5±55.0 °C(Predicted) | | density | 1.180±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.34±0.10(Predicted) | | color | White to Off-White | | Major Application | pharmaceutical (small molecule) | | InChI | 1S/C19H28N2O5/c1-19(2,3)9-10-20-14(12-16(22)23)17(24)21-15(18(25)26)11-13-7-5-4-6-8-13/h4-8,14-15,20H,9-12H2,1-3H3,(H,21,24)(H,22,23)(H,25,26)/t14-,15-/m0/s1 | | InChIKey | YHHAZJVJJCTGLB-GJZGRUSLSA-N | | SMILES | N([C@@H](CC(=O)O)C(=O)N[C@@H](Cc1ccccc1)C(=O)O)CCC(C)(C)C |
| WGK Germany | WGK 3 | | HS Code | 2924296000 | | Storage Class | 11 - Combustible Solids |
| | DMBAP Usage And Synthesis |
| Uses | N-(3,3-Dimethylbutyl)-L-α-aspartyl-L-phenylalanine is the hydrolysis product of Neotame (N390060). | | Uses | N-(3,3-Dimethylbutyl)-L-α-apartyl-L-phenylalanine is a metabolite of Neotame (N390060) which is a sweetener. |
| | DMBAP Preparation Products And Raw materials |
|