|
|
| | (S)-Methyl-2-Boc-AMino-4-pentenoic acid Basic information |
| Product Name: | (S)-Methyl-2-Boc-AMino-4-pentenoic acid | | Synonyms: | (S)-Methyl-2-Boc-AMino-4-pentenoic acid;4-Pentenoic acid, 2-[[(1,1-diMethylethoxy)carbonyl]aMino]-, Methylester, (2S)-;(2S)-2-(Boc-amino)-4-pentenoic acid methyl ester;(S)-Methyl 2-(tert-butoxycarbonylamino)-pent-4-enoate;Boc-Allylglycine methyl ester;Methyl (S)-2-(Boc-amino)-4-pentenoate;tert-butyl (S)-1-(methoxycarbonyl)but-3-enylcarbamate;methyl (2S)-2-(tert-butoxycarbonylamino)pent-4-enoate | | CAS: | 89985-87-5 | | MF: | C11H19NO4 | | MW: | 229.27 | | EINECS: | | | Product Categories: | | | Mol File: | 89985-87-5.mol |  |
| | (S)-Methyl-2-Boc-AMino-4-pentenoic acid Chemical Properties |
| Boiling point | 302.0±35.0 °C(Predicted) | | density | 1.035±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 11.08±0.46(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C11H19NO4/c1-6-7-8(9(13)15-5)12-10(14)16-11(2,3)4/h6,8H,1,7H2,2-5H3,(H,12,14)/t8-/m0/s1 | | InChIKey | APXWRHACXBILLH-QMMMGPOBSA-N | | SMILES | C(OC)(=O)[C@@H](NC(OC(C)(C)C)=O)CC=C |
| | (S)-Methyl-2-Boc-AMino-4-pentenoic acid Usage And Synthesis |
| | (S)-Methyl-2-Boc-AMino-4-pentenoic acid Preparation Products And Raw materials |
|