- (S)-N-Boc-allylglycine
-
- $1.00 / 1KG
-
2019-12-25
- CAS:90600-20-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 200kg
|
| | (S)-N-Boc-allylglycine Basic information |
| | (S)-N-Boc-allylglycine Chemical Properties |
| alpha | 10.5 º (c=1, methanol) | | Boiling point | 355.52°C (rough estimate) | | density | 1.1835 (rough estimate) | | refractive index | 1.4610 (estimate) | | storage temp. | 2-8°C | | solubility | Chloroform, Methanol | | form | Viscous Liquid | | pka | 3.83±0.10(Predicted) | | color | Clear pale yellow | | Optical Rotation | Consistent with structure | | InChI | InChI=1S/C10H17NO4/c1-5-6-7(8(12)13)11-9(14)15-10(2,3)4/h5,7H,1,6H2,2-4H3,(H,11,14)(H,12,13)/t7-/m0/s1 | | InChIKey | BUPDPLXLAKNJMI-ZETCQYMHSA-N | | SMILES | C(O)(=O)[C@@H](NC(OC(C)(C)C)=O)CC=C |
| Safety Statements | 24/25 | | HS Code | 29224985 |
| Provider | Language |
|
ACROS
| English |
| | (S)-N-Boc-allylglycine Usage And Synthesis |
| Chemical Properties | (S)-N-Boc-allylglycine is yellow oil or paste | | Uses | (S)-N-Boc-allylglycine is a boc-protected allylglycine used in the preparation of arginine analogues including the natural amino acid enduracididine. |
| | (S)-N-Boc-allylglycine Preparation Products And Raw materials |
|