| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:1,2-Bis[4-(azidomethyl)phenyl]-1,2-diphenylethene CAS:1054451-33-0 Purity:1,2-Bis[4-(azidomethyl)phenyl]-1,2-diphenylethene Package:25MG Remarks:797340-25MG
|
| Company Name: |
Shanghai Uchem Inc.
|
| Tel: |
15618758386 15618758386 |
| Email: |
sales3@myuchem.com |
| Products Intro: |
Product Name:1,2-bis(4-(azidomethyl)phenyl)-1,2-diphenylethene CAS:1054451-33-0 Purity:97% min. Package:10g;25g;100g
|
| Company Name: |
Zhengzhou Alfachem Co.,Ltd.
|
| Tel: |
0371-53778726 18003825608 |
| Email: |
liuxiaoyan@alfachem.cn |
| Products Intro: |
Product Name:Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- CAS:1054451-33-0 Purity:98% Package:25g;100g;500g;1kg;5kg
|
| Company Name: |
Zhengzhou Acme Chemical Co., Ltd.
|
| Tel: |
0371-0371-55629727 13323845623 |
| Email: |
2885676761@qq.com |
| Products Intro: |
Product Name:1,2-bis-(4-(azidomethyl)phenyl)-1,2-diphenylethene CAS:1054451-33-0 Purity:98%HPLC Package:10g;100g;500g;1kg;25kg
|
|
| | Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- Basic information |
| | Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- Chemical Properties |
| form | solid | | InChI | 1S/C28H22N6/c29-33-31-19-21-11-15-25(16-12-21)27(23-7-3-1-4-8-23)28(24-9-5-2-6-10-24)26-17-13-22(14-18-26)20-32-34-30/h1-18H,19-20H2/b28-27+ | | InChIKey | IXQXFSMBYFNNPN-BYYHNAKLSA-N | | SMILES | [N-]=[N+]=NCC(C=C1)=CC=C1/C(C2=CC=CC=C2)=C(C3=CC=CC=C3)/C4=CC=C(CN=[N+]=[N-])C=C4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- Usage And Synthesis |
| Uses | TPE-MN3 is an aggregation-induced emission (AIE) dye for "Click" reactions. |
| | Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- Preparation Products And Raw materials |
|