| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- Basic information |
| | Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- Chemical Properties |
| form | solid | | InChI | 1S/C28H22N6/c29-33-31-19-21-11-15-25(16-12-21)27(23-7-3-1-4-8-23)28(24-9-5-2-6-10-24)26-17-13-22(14-18-26)20-32-34-30/h1-18H,19-20H2/b28-27+ | | InChIKey | IXQXFSMBYFNNPN-BYYHNAKLSA-N | | SMILES | [N-]=[N+]=NCC(C=C1)=CC=C1/C(C2=CC=CC=C2)=C(C3=CC=CC=C3)/C4=CC=C(CN=[N+]=[N-])C=C4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- Usage And Synthesis |
| Uses | TPE-MN3 is an aggregation-induced emission (AIE) dye for "Click" reactions. |
| | Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(azidoMethyl)- Preparation Products And Raw materials |
|