| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
1,2-Bis[4-(bromomethyl)phenyl]-1,2-diphenylethene manufacturers
|
| | 1,2-Bis[4-(bromomethyl)phenyl]-1,2-diphenylethene Basic information |
| Product Name: | 1,2-Bis[4-(bromomethyl)phenyl]-1,2-diphenylethene | | Synonyms: | 1,2-Bis[4-(bromomethyl)phenyl]-1,2-diphenylethene;Benzene, 1,1'-(1,2-diphenyl-1,2-ethenediyl)bis[4-(bromomethyl)-;1,1′-(1,2-Diphenyl-1,2-ethenediyl)bis[4-(bromomethyl)benzene];TPE-MB;DK7711;1,2-bis(4-(bromethyl)phenyl)-1,2-dibenzenethylene | | CAS: | 1053241-67-0 | | MF: | C28H22Br2 | | MW: | 518.28 | | EINECS: | | | Product Categories: | | | Mol File: | 1053241-67-0.mol | ![1,2-Bis[4-(bromomethyl)phenyl]-1,2-diphenylethene Structure](CAS/20180703/GIF/1053241-67-0.gif) |
| | 1,2-Bis[4-(bromomethyl)phenyl]-1,2-diphenylethene Chemical Properties |
| Boiling point | 533.5±45.0 °C(Predicted) | | density | 1.421±0.06 g/cm3(Predicted) | | form | solid | | InChI | 1S/C28H22Br2/c29-19-21-11-15-25(16-12-21)27(23-7-3-1-4-8-23)28(24-9-5-2-6-10-24)26-17-13-22(20-30)14-18-26/h1-18H,19-20H2/b28-27+ | | InChIKey | GHZTXESUSOBGAM-BYYHNAKLSA-N | | SMILES | BrCC(C=C1)=CC=C1/C(C2=CC=CC=C2)=C(C3=CC=CC=C3)/C4=CC=C(CBr)C=C4 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1,2-Bis[4-(bromomethyl)phenyl]-1,2-diphenylethene Usage And Synthesis |
| Uses | TPE-MB is an intermediate of aggregation-induced emission (AIE) material used in the synthesis of blue mitochondrial dyes for bio-imaging. TPE-MB may be used in the preparation of aggregation induced emission (AIE) probes for the fluorescence detection of mercury(II) and glutathione. |
| | 1,2-Bis[4-(bromomethyl)phenyl]-1,2-diphenylethene Preparation Products And Raw materials |
|