Ptdins-(4)-P1 (1,2-dipalmitoyl) ammonium salt manufacturers
|
| | Ptdins-(4)-P1 (1,2-dipalmitoyl) ammonium salt Basic information |
| Product Name: | Ptdins-(4)-P1 (1,2-dipalmitoyl) ammonium salt | | Synonyms: | 08:0 PI(4)P;1,2-DIOCTANOYL-SN-GLYCERO-3-PHOSPHO-(1'-MYO-INOSITOL-4'-PHOSPHATE) (AMMONIUM SALT);08:0 PI(4)P;GRYUDEZZGXKOJR-JHABFHEXSA-N;1,2-dioctanoyl-sn-glycero-3-phospho-(1'-myo-inositol-4'-phosphate) (ammonium salt);1-(1,2-DIHEXADECANOYLPHOSPHATIDYL)INOSITOL-4-PHOSPHATE, AMMONIUM SALT;Ptdins-(4)-P1 (1,2-dipalmitoyl) ammonium salt | | CAS: | 1246303-11-6 | | MF: | C25H54N2O16P2 | | MW: | 700.647582 | | EINECS: | | | Product Categories: | | | Mol File: | 1246303-11-6.mol |  |
| | Ptdins-(4)-P1 (1,2-dipalmitoyl) ammonium salt Chemical Properties |
| storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | form | A lyophilized powder | | InChIKey | GRYUDEZZGXKOJR-JHABFHEXSA-N | | SMILES | [H][C@@](COP([O-])(O[C@H]1[C@H](O)[C@@H](O)[C@H](OP([O-])(O)=O)[C@@H](O)[C@H]1O)=O)(OC(CCCCCCC)=O)COC(CCCCCCC)=O.[NH4+].[NH4+] |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Ptdins-(4)-P1 (1,2-dipalmitoyl) ammonium salt Usage And Synthesis |
| Uses | Glycerophospholipids act as regulators of various enzyme activities, and can be used as biological markers to indicate pathological states. | | Biological Activity | 08:0 PIP can control ion channel activity. Phosphoinositol phosphates (PIPs) with short acyl chains, th at are soluble in water can be used for reversible transport into the plasma membrane. |
| | Ptdins-(4)-P1 (1,2-dipalmitoyl) ammonium salt Preparation Products And Raw materials |
|