- (S)-crizotinib
-
- $30.00
-
2026-07-14
- CAS:1374356-45-2
- Purity: 99.89%
- Supply Ability: 10g
|
| | 2-Pyridinamine, 3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-piperidinyl)-1H-pyrazol-4-yl]- Basic information |
| | 2-Pyridinamine, 3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-piperidinyl)-1H-pyrazol-4-yl]- Chemical Properties |
| Boiling point | 599.2±50.0 °C(Predicted) | | density | 1.47±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMF: 5 mg/ml; DMF:PBS (pH 7.2) (1:1): 0.5 mg/ml; DMSO: 0.5 mg/ml; Ethanol: 0.5 mg/ml | | form | A solid | | pka | 9.81±0.10(Predicted) | | color | Light yellow to yellow | | InChI | 1S/C21H22Cl2FN5O/c1-12(19-16(22)2-3-17(24)20(19)23)30-18-8-13(9-27-21(18)25)14-10-28-29(11-14)15-4-6-26-7-5-15/h2-3,8-12,15,26H,4-7H2,1H3,(H2,25,27)/t12-/m0/s1 | | InChIKey | KTEIFNKAUNYNJU-LBPRGKRZSA-N | | SMILES | ClC1=C([C@H](C)OC2=C(N)N=CC(C3=CN(C4CCNCC4)N=C3)=C2)C(Cl)=C(F)C=C1 | | CAS DataBase Reference | 1374356-45-2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 2-Pyridinamine, 3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-piperidinyl)-1H-pyrazol-4-yl]- Usage And Synthesis |
| Characteristics | MTH1 (NUDT1)-selective inhibitor. | | Uses | (S)-Crizotinib is the S-isomer of Crizotinib (C785000) and a novel potent, selective, and cell permeable MTH1 inhibitor. (S)-Crizotinib can also serve as a promising anticancer agent. | | Definition | ChEBI: Ent-crizotinib is a 3-[1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(piperidin-4-yl)pyrazol-4-yl]pyridin-2-amine that is the (S)-enantiomer of crizotinib. It is an enantiomer of a crizotinib. | | Biological Activity | (S)-crizotinib, (S)enantiomer-crizotinib, is a potent MTH1 (NUDT1) inhibitor with IC50 of 72 nM. | | target | | Target | Value | MTH1
(Cell-free assay) | 72 nM |
| | storage | Store at RT |
| | 2-Pyridinamine, 3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-5-[1-(4-piperidinyl)-1H-pyrazol-4-yl]- Preparation Products And Raw materials |
|