| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Alfa Chemistry |
| Tel: |
+1-5166625404; |
| Email: |
Info@alfa-chemistry.com |
|
| | 7-Methylguanosine 5'-diphosphate sodium salt Basic information |
| | 7-Methylguanosine 5'-diphosphate sodium salt Chemical Properties |
| storage temp. | -20°C | | solubility | water: 50 mg/mL, clear to very slightly hazy, colorless to very faintly yellow | | form | Solid | | color | White to off-white | | biological source | synthetic (organic) | | Water Solubility | water: 50mg/mL, clear to very slightly hazy, colorless to very faintly yellow | | InChIKey | VSMXIKIFPKDZJA-JHVGCDEENA-L | | SMILES | C12N=C(N=C([O-])C=1[N+](C)=CN2[C@H]1[C@H](O)[C@H](O)[C@@H](COP([O-])(=O)OP([O-])(=O)O)O1)N.[Na+].[Na+] |&1:11,12,14,16,r| |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 7-Methylguanosine 5'-diphosphate sodium salt Usage And Synthesis |
| Uses | 7-Methylguanosine 5′-diphosphate (m7GDP) may be used to study the structure, functions and metabolism of mRNA 5′-cap structures. M7GDP is used in the synthesis of mRNA cap analogues. | | Definition | ChEBI: A purine ribonucleoside 5'-diphosphate having 7-methyl-7,8-dihydroguanine as the nucleobase. | | IC 50 | Human Endogenous Metabolite |
| | 7-Methylguanosine 5'-diphosphate sodium salt Preparation Products And Raw materials |
|