| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
Maleic acid monosodium salt manufacturers
|
| | Maleic acid monosodium salt Basic information |
| Product Name: | Maleic acid monosodium salt | | Synonyms: | 2-Butenedioicacid(Z)-,monosodiumsalt;maleicacidmonosodiumsigmaultra;SODIUM HYDROGEN MALEATE;SODIUM BIMALEATE;MALEIC ACID MONOSODIUM;monosodium maleate;MALEICACID,MONOSODIUMSALT,ULTRAPURE;Maleic Acid Monosodium Salt Trihydrate | | CAS: | 3105-55-3 | | MF: | C4H3NaO4 | | MW: | 138.05 | | EINECS: | 221-461-6 | | Product Categories: | | | Mol File: | 3105-55-3.mol |  |
| | Maleic acid monosodium salt Chemical Properties |
| solubility | H2O: 1 M at 20 °C, clear, colorless | | form | Liquid | | color | White to Almost white | | InChI | 1S/C4H4O4.Na/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+1/p-1/b2-1-; | | InChIKey | VRVKOZSIJXBAJG-ODZAUARKSA-M | | SMILES | OC(/C=C\C([O-])=O)=O.[Na+] | | CAS DataBase Reference | 3105-55-3 | | EPA Substance Registry System | 2-Butenedioic acid (2Z)-, monosodium salt (3105-55-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | ON3500000 | | TSCA | TSCA listed | | HS Code | 2917.19.2700 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | Maleic acid monosodium salt Usage And Synthesis |
| Uses | Maleate trihydrate sodiumIt is an organic compound belonging to the salt class. It is formed from the neutralization reaction between maleic acid and sodium hydroxide and has a slightly bitter taste. Maleate trihydrate sodiumIt has a variety of applications in industrial settings, especially as an intermediate in the synthesis of various chemicals and polymers. Additionally, it is used in the food and beverage industry as a buffer, flavor enhancer and preservative. | | Biochem/physiol Actions | Maleic acid is a component of cosmetics, fragrances and has industrial applications. It is also a potent nephrotoxin and is implicated to induce glycosuria, aminoaciduria and Fanconi syndrome. |
| | Maleic acid monosodium salt Preparation Products And Raw materials |
|