- BOC-CIT-OH
-
- $0.00 / 1kg
-
2023-12-04
- CAS:45234-13-7
- Min. Order: 0.1kg
- Purity: 98%
- Supply Ability: 100kg
|
| | BOC-CIT-OH Basic information |
| Product Name: | BOC-CIT-OH | | Synonyms: | NALPHA-BOC-L-CITRULLINE;N-ALPHA-T-BUTOXYCARBONYL-L-CITRULLINE;N-ALPHA-T-BUTOXYCARBONYL, DELTA-CARBAMOYL-L-ORNITHINE;5-(carbamoylamino)-2-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]pentanoic acid;(2S)-2-{[(tert-butoxy)carbonyl]amino}-5-(carbamoylamino)pentanoic acid;nα-boc-l-citrulline;Boc-L-Cit-OH;NALPHA-tert-Butoxycarbonyl-L-citrulline | | CAS: | 45234-13-7 | | MF: | C11H21N3O5 | | MW: | 275.3 | | EINECS: | | | Product Categories: | | | Mol File: | 45234-13-7.mol |  |
| | BOC-CIT-OH Chemical Properties |
| Melting point | ~60 °C | | Boiling point | 483.0±45.0 °C(Predicted) | | density | 1.212±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO | | form | Solid | | pka | 3.95±0.21(Predicted) | | color | White Foaming | | InChI | InChI=1S/C11H21N3O5/c1-11(2,3)19-10(18)14-7(8(15)16)5-4-6-13-9(12)17/h7H,4-6H2,1-3H3,(H,14,18)(H,15,16)(H3,12,13,17)/t7-/m0/s1 | | InChIKey | CMJCWQISQGNHHI-ZETCQYMHSA-N | | SMILES | C(O)(=O)[C@H](CCCNC(N)=O)NC(OC(C)(C)C)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | HazardClass | IRRITANT | | HS Code | 2924297099 |
| | BOC-CIT-OH Usage And Synthesis |
| Chemical Properties | White to pale yellow powder | | Uses | Boc-L-citrulline is an intermediate in the synthesis of Arginino-succinic Acid Disodium Salt (A769200). Arginino-succinic Acid Sodium Salt is used in the characterization of δ-crystallin in avian species. |
| | BOC-CIT-OH Preparation Products And Raw materials |
|