2,3-Difluoro-4-methoxybenzoic acid manufacturers
|
| | 2,3-Difluoro-4-methoxybenzoic acid Basic information |
| | 2,3-Difluoro-4-methoxybenzoic acid Chemical Properties |
| Melting point | 222-224°C | | storage temp. | 2-8°C | | InChI | InChI=1S/C8H6F2O3/c1-13-5-3-2-4(8(11)12)6(9)7(5)10/h2-3H,1H3,(H,11,12) | | InChIKey | OBSJPUVORWCLNA-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(OC)C(F)=C1F | | CAS DataBase Reference | 329014-60-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Hazard Note | Irritant | | HS Code | 2918999090 |
| | 2,3-Difluoro-4-methoxybenzoic acid Usage And Synthesis |
| | 2,3-Difluoro-4-methoxybenzoic acid Preparation Products And Raw materials |
|