| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 1-(2-HYDROXY-5-ISOPROPYLPHENYL)PROPAN-1-ONE Basic information |
| Product Name: | 1-(2-HYDROXY-5-ISOPROPYLPHENYL)PROPAN-1-ONE | | Synonyms: | 1-(2-HYDROXY-5-ISOPROPYLPHENYL)PROPAN-1-ONE;2'-HYDROXY-5'-ISOPROPYLPROPIOPHENONE;JRH-01108, 1-(2-Hydroxy-5-isopropylphenyl)propan-1-one, 97%;1-Propanone, 1-[2-hydroxy-5-(1-methylethyl)phenyl]-;1-[2-Hydroxy-5-(1-methylethyl)phenyl]-1-propanone | | CAS: | 288401-26-3 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | | | Product Categories: | | | Mol File: | 288401-26-3.mol |  |
| | 1-(2-HYDROXY-5-ISOPROPYLPHENYL)PROPAN-1-ONE Chemical Properties |
| Boiling point | 275.8±20.0 °C(Predicted) | | density | 1.033±0.06 g/cm3(Predicted) | | form | solid | | pka | 8.53±0.48(Predicted) | | InChI | 1S/C12H16O2/c1-4-11(13)10-7-9(8(2)3)5-6-12(10)14/h5-8,14H,4H2,1-3H3 | | InChIKey | HEDRGRJCHGRJHM-UHFFFAOYSA-N | | SMILES | CCC(C1=C(O)C=CC(C(C)C)=C1)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
| | 1-(2-HYDROXY-5-ISOPROPYLPHENYL)PROPAN-1-ONE Usage And Synthesis |
| | 1-(2-HYDROXY-5-ISOPROPYLPHENYL)PROPAN-1-ONE Preparation Products And Raw materials |
|