| Company Name: |
Heyuan broad spectrum Biotechnology Co., Ltd Gold
|
| Tel: |
0762-3393039 18023108599 |
| Email: |
2853058244@qq.com |
| Products Intro: |
Product Name:Roxadustat impurity 5
CAS:1509958-19-3
Purity:98+ Package:25mg;100mg;200mg
|
| Company Name: |
Quality Control Solutions Ltd.
|
| Tel: |
66853366 13670046396 |
| Email: |
sales@chem-strong.com |
| Products Intro: |
Product Name:Roxadustat Impurity 35
CAS:1509958-19-3
Purity:95% HPLC Package:10mg;25mg;50mg;100mg
|
FG-4592 intermediate7 manufacturers
|
| | FG-4592 intermediate7 Basic information |
| Product Name: | FG-4592 intermediate7 | | Synonyms: | FG-4592 intermediate7;methyl-1-((dimethylamino)methyl)-4-hydroxy-7-phenoxyisoquinoline-3-carboxylate;ROXA-032;3-Isoquinolinecarboxylic acid, 1-[(dimethylamino)methyl]-4-hydroxy-7-phenoxy-, methyl ester;Roxadustat Impurity 35;Roxadustat Impurity 5;RSYY(Vorapaxar Sulfatet)-16 | | CAS: | 1509958-19-3 | | MF: | C20H20N2O4 | | MW: | 352.38 | | EINECS: | | | Product Categories: | | | Mol File: | 1509958-19-3.mol |  |
| | FG-4592 intermediate7 Chemical Properties |
| Boiling point | 554.1±50.0 °C(Predicted) | | density | 1.257±0.06 g/cm3(Predicted) | | pka | 4.84±0.50(Predicted) | | InChI | InChI=1S/C20H20N2O4/c1-22(2)12-17-16-11-14(26-13-7-5-4-6-8-13)9-10-15(16)19(23)18(21-17)20(24)25-3/h4-11,23H,12H2,1-3H3 | | InChIKey | ZIKSUKAGLAJTQJ-UHFFFAOYSA-N | | SMILES | C1(CN(C)C)C2=C(C=CC(OC3=CC=CC=C3)=C2)C(O)=C(C(OC)=O)N=1 |
| | FG-4592 intermediate7 Usage And Synthesis |
| | FG-4592 intermediate7 Preparation Products And Raw materials |
|