| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 1-Methyl-1H-imidazole-5-carboxaldehyde Basic information | | Synthesis |
| | 1-Methyl-1H-imidazole-5-carboxaldehyde Chemical Properties |
| Melting point | 52-57 °C | | Boiling point | 120-130°C 2mm | | density | 1.14±0.1 g/cm3(Predicted) | | Fp | >230 °F | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | pka | 3.87±0.10(Predicted) | | form | solid | | color | Light yellow | | Sensitive | Air Sensitive | | InChI | InChI=1S/C5H6N2O/c1-7-4-6-2-5(7)3-8/h2-4H,1H3 | | InChIKey | BNYKZFOZWZMEJD-UHFFFAOYSA-N | | SMILES | C1N(C)C(C=O)=CN=1 | | CAS DataBase Reference | 39021-62-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-43 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29332900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| | 1-Methyl-1H-imidazole-5-carboxaldehyde Usage And Synthesis |
| Synthesis | Starting with 5-aldehyde imidazolium and methyl trifluoromethanesulfonate, this study aimed to develop a promising industrial process for producing 1-METHYL-1H-IMIDAZOLE-5-CARBOXALDEHYDE. Various catalysts were screened, and the effects of reaction time, temperature, feed ratio, and pressure on imidazolium conversion and 2-chloro-1-methyl-1H-imidazolium yield were investigated. The reaction conditions were optimized, and the optimal process conditions were determined. The synthetic reaction formula is shown in the figure below: 
| | Uses | 1-Methyl-1H-imidazole-5-carbaldehyde used as a photoresponsive polymer and metal-organic backbone material for the preparation of hybrid matrix membranes. |
| | 1-Methyl-1H-imidazole-5-carboxaldehyde Preparation Products And Raw materials |
|