|
|
| | tert-Butyl 2,7-diazaspiro[4.5]decane-2-carboxylate Basic information |
| Product Name: | tert-Butyl 2,7-diazaspiro[4.5]decane-2-carboxylate | | Synonyms: | 2-Boc-2,7-diazaspiro[4.5]...;2,7-Diazaspiro[4.5]decane-2-carboxylic acid tert-butyl ester;2-Boc-2,7-diazaspiro[4.5]decane;2-Boc-2,7-diazaspiro[4.5]decane oxalate;2,7-Diazaspiro[4.5]decane-2-carboxylic acid, 1,1-diMethylethyl ester;tert-butyl 2,7-diazaspiro[4.5]decane-2-carboxylate - [B87735];tert-Butyl 2,7-diazaspiro[4.5]decane-2-carboxylate | | CAS: | 885268-42-8 | | MF: | C13H24N2O2 | | MW: | 240.34 | | EINECS: | | | Product Categories: | | | Mol File: | 885268-42-8.mol | ![tert-Butyl 2,7-diazaspiro[4.5]decane-2-carboxylate Structure](CAS/GIF/885268-42-8.gif) |
| | tert-Butyl 2,7-diazaspiro[4.5]decane-2-carboxylate Chemical Properties |
| Boiling point | 337℃ | | density | 1.07 | | Fp | 158℃ | | storage temp. | 2-8°C | | pka | 11.21±0.20(Predicted) | | Appearance | Colorless to off-white Solid-liquid mixture | | InChI | InChI=1S/C13H24N2O2/c1-12(2,3)17-11(16)15-8-6-13(10-15)5-4-7-14-9-13/h14H,4-10H2,1-3H3 | | InChIKey | OGAFPCPHUIPWEO-UHFFFAOYSA-N | | SMILES | C1C2(CCCNC2)CCN1C(OC(C)(C)C)=O |
| Risk Statements | 52 | | HS Code | 2933998090 |
| | tert-Butyl 2,7-diazaspiro[4.5]decane-2-carboxylate Usage And Synthesis |
| | tert-Butyl 2,7-diazaspiro[4.5]decane-2-carboxylate Preparation Products And Raw materials |
|