|
|
| | tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate Basic information | | Synthesis Uses |
| Product Name: | tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate | | Synonyms: | tert-butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate hydrochloride;2,9-Diazaspiro[5.5]undecane-9-carboxylic acid, 1,1-dimethylethyl ester;9-diazaspiro[5.5]undecane-2-carboxylate;tert Butyl 2;1-tert-butyl-2,9-diazaspiro[5.5]undecane-2-carboxylate;2,9-Diazaspiro[5.5]undecan-9-carboxylic acid tert-butyl ester;9-Boc-2,9-diazaspiro[5.5]undecane;tert-Butyl 2,9-diazaspiro[5_5]undecane-9-carboxylate xhydrochloride | | CAS: | 1023595-19-8 | | MF: | C14H26N2O2 | | MW: | 254.37 | | EINECS: | | | Product Categories: | | | Mol File: | 1023595-19-8.mol | ![tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate Structure](CAS2/GIF/1023595-19-8.gif) |
| | tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate Chemical Properties |
| Boiling point | 354.1±35.0 °C(Predicted) | | density | 1.05 | | storage temp. | 2-8°C(protect from light) | | pka | 11.22±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C14H26N2O2/c1-13(2,3)18-12(17)16-9-6-14(7-10-16)5-4-8-15-11-14/h15H,4-11H2,1-3H3 | | InChIKey | QDWTYWWOUAIWGI-UHFFFAOYSA-N | | SMILES | C1C2(CCN(C(OC(C)(C)C)=O)CC2)CCCN1 |
| Hazard Codes | F | | Risk Statements | 11 | | Safety Statements | 7-16 | | TSCA | No | | HS Code | 2933998090 |
| | tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate Usage And Synthesis |
| Synthesis | N-Boc-4-piperidine methanol was dissolved in anhydrous chloroform, 10 mL of anhydrous chloropropylamine solution was added, 5 mL of chloroform solution of p-toluenesulfonic acid was added, 4A molecular sieve was added, the reaction mixture was refluxed for 96 h, after the reaction was completed, the mixture was filtered through Na2CO3, the solvent was removed from the filtrate, and the crude product was recrystallized in isopropyl ether to obtain pure tert-butyl 2,9-diazaspiro[5.5]undecane-2-carboxylate. Figure TERT-BUTYL 2,9-DIAZASPIRO[5.5]UNDECANE-9-CARBOXYLATE synthesis reaction formula | | Uses | 2,9-diazaspiro[5.5]undecane-2-carboxylic acid tert-butyl ester is a carboxylic acid ester derivative used as an organic intermediate for organic synthesis and experimental research. | | Chemical Properties | white solid |
| | tert-Butyl 2,9-diazaspiro[5.5]undecane-9-carboxylate Preparation Products And Raw materials |
|