| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 6,7-Dimethoxyquinazoline-2,4-dione Basic information |
| Product Name: | 6,7-Dimethoxyquinazoline-2,4-dione | | Synonyms: | QUINAZOLINDIONE;2,4-Dihydroxy-6,7-dimethoxquinazoline;2,4-DIONE-6,7-DIMETHOXYQUINAZOLINE;2,4-DIHYDROXY-6,7-DIMETHOXYQUINAZOLINE;LABOTEST-BB LT00453115;1,2,3,4-TETRAHYDRO-6,7-DIMETHOXYQUINAZOLINE-2,4-DIONE;6,7-DIMETHOXY-(1H,3H)-2,4-QUINAZOLINDIONE;6,7-DIMETHOXY-2,4(1H,3H)-QUINAZOLINEDIONE | | CAS: | 28888-44-0 | | MF: | C10H10N2O4 | | MW: | 222.2 | | EINECS: | 249-288-1 | | Product Categories: | Aromatics;Heterocycles;Intermediates & Fine Chemicals;Pharmaceuticals;Building Blocks;Heterocyclic Building Blocks;Quinazolines;Quinoline&Isoquinoline;Doxazosin;Quinolines, Quinazolines and derivatives | | Mol File: | 28888-44-0.mol |  |
| | 6,7-Dimethoxyquinazoline-2,4-dione Chemical Properties |
| Melting point | >300 °C (lit.) | | Boiling point | 363.37°C (rough estimate) | | density | 1.3404 (rough estimate) | | refractive index | 1.6300 (estimate) | | storage temp. | 2-8°C | | solubility | Aqueous Acid (Sparingly) | | pka | 10.27±0.20(Predicted) | | color | White to Off-White | | Water Solubility | insoluble | | BRN | 204597 | | InChI | 1S/C10H10N2O4/c1-15-7-3-5-6(4-8(7)16-2)11-10(14)12-9(5)13/h3-4H,1-2H3,(H2,11,12,13,14) | | InChIKey | KWNQIIMVPSMYEM-UHFFFAOYSA-N | | SMILES | COc1cc2NC(=O)NC(=O)c2cc1OC | | CAS DataBase Reference | 28888-44-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | HS Code | 29339990 | | Storage Class | 11 - Combustible Solids |
| | 6,7-Dimethoxyquinazoline-2,4-dione Usage And Synthesis |
| Chemical Properties | brown powder | | Uses | 6,7-Dimethoxyquinazoline-2,4-dione (Doxazosin EP Impurity D) is an intermediate in the preparation of Alfuzosin hydrochloride (A532000), an antihypertensive. |
| | 6,7-Dimethoxyquinazoline-2,4-dione Preparation Products And Raw materials |
|