3-Amino-N,N-dimethylbenzylamine manufacturers
|
| | 3-Amino-N,N-dimethylbenzylamine Basic information |
| Product Name: | 3-Amino-N,N-dimethylbenzylamine | | Synonyms: | 3-DIMETHYLAMINOMETHYL-ANILINE;Aminobenzyldimethylamin (Isomerengemisch);3-AMINOBENZYL-N,N-DIMETHYLAMINE;3-Amino-N,N-dimethylbenzenemethanamine;Einecs 248-747-3;3-Amino-N,N-dimethylbenzylamin ,98%;3-((diMethylaMino)Methyl)benzenaMine;Benzenemethanamine, 3-amino-N,N-dimethyl- (9CI) | | CAS: | 27958-77-6 | | MF: | C9H14N2 | | MW: | 150.22 | | EINECS: | 248-747-3 | | Product Categories: | AMINEPRIMARY | | Mol File: | 27958-77-6.mol |  |
| | 3-Amino-N,N-dimethylbenzylamine Chemical Properties |
| Melting point | 44-46 °C(Solv: ligroine (8032-32-4)) | | Boiling point | 130 °C(Press: 0.1 Torr) | | density | 1.013±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 8.92±0.28(Predicted) | | Appearance | Light brown to yellow Solid | | InChI | InChI=1S/C9H14N2/c1-11(2)7-8-4-3-5-9(10)6-8/h3-6H,7,10H2,1-2H3 | | InChIKey | WOJBIBHVUSZAGS-UHFFFAOYSA-N | | SMILES | C1(CN(C)C)=CC=CC(N)=C1 |
| | 3-Amino-N,N-dimethylbenzylamine Usage And Synthesis |
| Uses | 3-amino-n,n-dimethylbenzylamine is used as a reagent in the preparation of amino-triazole-carboxamide derivatives for use in Trypanosoma cruzi. |
| | 3-Amino-N,N-dimethylbenzylamine Preparation Products And Raw materials |
|