|
|
| | 5-CHLORO-2-HYDROXYPYRIMIDINE Basic information |
| | 5-CHLORO-2-HYDROXYPYRIMIDINE Chemical Properties |
| Melting point | 237-238 °C (decomp) | | density | 1.55±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | pka | 7.62±0.10(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C4H3ClN2O/c5-3-1-6-4(8)7-2-3/h1-2H,(H,6,7,8) | | InChIKey | OCSYCDVQABSEPJ-UHFFFAOYSA-N | | SMILES | C1(=O)NC=C(Cl)C=N1 | | CAS DataBase Reference | 54326-16-8(CAS DataBase Reference) | | EPA Substance Registry System | 2(1H)-Pyrimidinone, 5-chloro- (54326-16-8) |
| Hazard Codes | Xn | | Risk Statements | 22 | | TSCA | TSCA listed | | HS Code | 2933599590 |
| | 5-CHLORO-2-HYDROXYPYRIMIDINE Usage And Synthesis |
| Chemical Properties | Pale yellow crystals | | Uses | 5-Chloro-2-hydroxypyrimidine is used to prepare dimethoxy-pyrrolidylquinazolines as brain penetrable PDE10A inhibitors. It is also used in the synthesis of platinum(II) hydroxypyrimidinato ethylenediamine tetranuclear metallacalix[4]arene complexes. |
| | 5-CHLORO-2-HYDROXYPYRIMIDINE Preparation Products And Raw materials |
|