| Company Name: |
Alfa Aesar |
| Tel: |
400-6106006 |
| Email: |
saleschina@alfa-asia.com |
| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 2-Nitrophenyl-beta-D-glucopyranoside Basic information |
| | 2-Nitrophenyl-beta-D-glucopyranoside Chemical Properties |
| Melting point | 141-142℃ | | Boiling point | 572.4±50.0 °C(Predicted) | | density | 1.599±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | Methanol (Slightly), Water (Slightly) | | form | powder | | pka | 12.69±0.70(Predicted) | | color | light yellow | | Water Solubility | Soluble in water | | BRN | 92206 | | InChI | InChI=1/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-4-2-1-3-6(7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9+,10+,11-,12-/s3 | | InChIKey | KUWPCJHYPSUOFW-IDEGKBHYNA-N | | SMILES | [C@@H]1([C@H](O)[C@H]([C@@H](O)[C@@H](CO)O1)O)OC1C=CC=CC=1[N+]([O-])=O |&1:0,1,3,4,6,r| | | CAS DataBase Reference | 2816-24-2(CAS DataBase Reference) |
| | 2-Nitrophenyl-beta-D-glucopyranoside Usage And Synthesis |
| Chemical Properties | Light yellow powder | | Uses | 2-Nitrophenyl b-D-Glucopyranoside is used in preparation of phenol glycosides and their use in treatment of urolithiasis. | | Biological Activity | 2-Nitrophenyl β-D-glucopyranoside serves as an artificial substrate for glucosidase. |
| | 2-Nitrophenyl-beta-D-glucopyranoside Preparation Products And Raw materials |
|