|
|
| Product Name: | METHYL NONAFLUOROBUTYL ETHER | | Synonyms: | 1H,1H,1H-NONAFLUORO-2-OXAHEXANE;1-(METHOXY)NONAFLUOROBUTANE;METHYL NONAFLUOROBUTYL ETHER;Methoxyperfluoro-n-butane;2-bromo-1-[4-(2-bromo-1-oxopropyl)-1-piperazinyl]-1-propanone;Methoxyperfluorobutane 99%, mixture of n- and iso-butyl isomers;Methyl nonafluorobutyl ether (NOVEC 7100;Methyl Perfluorobutyl Ether (NOVEC 7100 | | CAS: | 163702-07-6 | | MF: | C5H3F9O | | MW: | 250.06 | | EINECS: | 605-339-3 | | Product Categories: | | | Mol File: | 163702-07-6.mol |  |
| | METHYL NONAFLUOROBUTYL ETHER Chemical Properties |
| Melting point | -135 °C (lit.) | | Boiling point | 60 °C (lit.) | | density | 1.529 g/mL at 20 °C
1.52 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.3(lit.) | | Fp | -18℃ | | storage temp. | 2-8°C | | form | liquid | | BRN | 8768491 | | Henry's Law Constant | 9.9×10-6 mol/(m3Pa) at 25℃, Zhang et al. (2010) | | Cosmetics Ingredients Functions | VISCOSITY CONTROLLING SOLVENT | | InChI | InChI=1S/C5H3F9O/c1-15-5(13,14)3(8,9)2(6,7)4(10,11)12/h1H3 | | InChIKey | OKIYQFLILPKULA-UHFFFAOYSA-N | | SMILES | C(F)(F)(F)C(F)(F)C(F)(F)C(F)(F)OC | | LogP | 4.670 (est) | | CAS DataBase Reference | 163702-07-6(CAS DataBase Reference) | | EPA Substance Registry System | Butane, 1,1,1,2,2,3,3,4,4-nonafluoro-4-methoxy- (163702-07-6) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 23-24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | TSCA | TSCA listed | | HS Code | 29091990 | | Storage Class | 10 - Combustible liquids |
| | METHYL NONAFLUOROBUTYL ETHER Usage And Synthesis |
| Application | Methyl Perfluorobutyl Ether is a clear, colorless, low-odor, non-toxic, non-corrosive, non-flammable liquid substance with a chemical formula of C5H3F9O and a molecular weight of 250.06. Since it has low flammability, relatively low vapor pressure, low heat of vaporization, and low surface tension, it is considered to replace the chlorine-containing cleaning solvents such as 1,1,1-trichloroethane, CFC-113 (CF2ClCFCl2), and HCFC-141b (CH3CFCl2). Besides, it is a fluorinated ether solvent that is very compatible with many other ingredients, and is thought to have good sliding properties and serve as a good solvent in oil-based formulas.
| | Preparation | Because methyl perfluorobutyl ether contains perfluoroalkyl group (Rf) on one side and alkyl group (R) on the other side of ether linkage, it cannot be synthesized by selective partial fluorination of its hydrocarbon precursors. Instead, they may be prepared by coupling reactions of two reactants having Rf and R, coupling reactions of two reactants having Rf and R, respectively. | | Chemical Properties | Clear colorless liquid | | Uses | Nonafluorobutyl methyl ether (Methyl Nonafluorobutyl Ether, MFE) may be used to compose mixed-solvent electrolytes. Flash point, conductivity and NMR spectra of these solvent mixtures have been investigated. | | Uses | Methoxyperfluorobutane can be used as a solvent:
- In the synthesis of various aryl fluoride derivatives via electrophilic fluorination of aryl and heteroaryl Grignard reagents.
- In grafting of fluorinated diblock copolymers onto silica particles.
| | General Description | consists of two inseparable isomers (CF3)2CFCF2OCH3 and CF3(CF2)3OCH3 with almost identical properties |
| | METHYL NONAFLUOROBUTYL ETHER Preparation Products And Raw materials |
|