|
|
| | Perfluoro-3,6,9-trioxatridecanoic acid Basic information |
| Product Name: | Perfluoro-3,6,9-trioxatridecanoic acid | | Synonyms: | 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]acetic acid;Difluoro{1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(nonafluorobutoxy)ethoxy]ethoxy}acetic acid, 2,2-Difluoro-2-{1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(nonafluorobutoxy)etho;Perfluoro-3,6,9-trioxatridecanoic acid 98%;Perfluoro-3,6,9-trioxatridecanoicacid98%;Acetic acid, 2,2-difluoro-2-[1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy]-;2,2-Difluoro-2-(1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoro-2-(perfluorobutoxy)ethoxy)ethoxy)acetic acid;Difluoro{1,1,2,2-tetrafluoro-2-[1,1,2,2-tetrafluoro-2-(1,1,2,2,3,3,4,4,4-nonafluorobutoxy)ethoxy]ethoxy}acetic acid;Perfluoro-3,6,9-trioxatridecanoic acid 98% | | CAS: | 330562-41-9 | | MF: | C10HF19O5 | | MW: | 562.08 | | EINECS: | | | Product Categories: | | | Mol File: | 330562-41-9.mol |  |
| | Perfluoro-3,6,9-trioxatridecanoic acid Chemical Properties |
| Boiling point | 292.7±40.0 °C(Predicted) | | density | 1.805±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | form | liquid | | pka | 0.21±0.10(Predicted) | | color | Clear | | InChI | InChI=1S/C17H13N4S.ClH/c1-3-8-14(9-4-1)20-18-17(16-12-7-13-22-16)19-21(20)15-10-5-2-6-11-15;/h1-13H;1H/q+1;/p-1 | | InChIKey | GDQLSTSWOFAQNO-UHFFFAOYSA-N | | SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(F)(F)OC(F)(F)C(=O)O | | EPA Substance Registry System | Perfluoro-3,6,9-trioxatridecanoic acid (330562-41-9) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39 | | RIDADR | 3265 | | WGK Germany | WGK 3 | | HazardClass | CORROSIVE | | HS Code | 29159000 | | Storage Class | 10 - Combustible liquids |
| | Perfluoro-3,6,9-trioxatridecanoic acid Usage And Synthesis |
| Chemical Properties | Clear colourless liquid | | Uses | Perfluoro-3,6,9-trioxatridecanoic Acid can be used as treatment fluids containing a perfluorinated chelating agent. |
| | Perfluoro-3,6,9-trioxatridecanoic acid Preparation Products And Raw materials |
|