|
|
| | 1-Oxa-6-azaspiro[3.4]octane hemioxalate Basic information |
| | 1-Oxa-6-azaspiro[3.4]octane hemioxalate Chemical Properties |
| storage temp. | 2-8°C, sealed storage, away from moisture and light | | Appearance | White to off-white Solid | | InChI | InChI=1S/2C6H11NO.C2H2O4/c2*1-3-7-5-6(1)2-4-8-6;3-1(4)2(5)6/h2*7H,1-5H2;(H,3,4)(H,5,6) | | InChIKey | ZUGYAGVFZOLOND-UHFFFAOYSA-N | | SMILES | C12(CNCC1)CCO2.C12(CNCC1)CCO2.C(O)(=O)C(O)=O |
| | 1-Oxa-6-azaspiro[3.4]octane hemioxalate Usage And Synthesis |
| Uses | 1-Oxa-6-azaspiro[3.4]octane hemioxalate can be used in organic synthesis and scientific research experiments.
|
| | 1-Oxa-6-azaspiro[3.4]octane hemioxalate Preparation Products And Raw materials |
|