| Company Name: |
Suzhouhongxiong Gold |
| Tel: |
18051745768 |
| Email: |
Suzhouhongxiong@163.com |
|
| | beta-(2-Thienyl)-DL-serine Basic information |
| | beta-(2-Thienyl)-DL-serine Chemical Properties |
| Melting point | 175 °C (decomp) | | Boiling point | 426.577±45.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.496±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | pka | 2.001±0.10(predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1/C7H9NO3S/c8-5(7(10)11)6(9)4-2-1-3-12-4/h1-3,5-6,9H,8H2,(H,10,11)/t5-,6/s3 | | InChIKey | GNUCLSFLDHLOBV-XETGPIDONA-N | | SMILES | C1(SC=CC=1)C(O)[C@H](N)C(=O)O |&1:7,r| | | CAS DataBase Reference | 32595-59-8 |
| WGK Germany | 3 | | HS Code | 29349990 |
| | beta-(2-Thienyl)-DL-serine Usage And Synthesis |
| Chemical Properties | Crystalline |
| | beta-(2-Thienyl)-DL-serine Preparation Products And Raw materials |
|