| Company Name: |
BOC Sciences |
| Tel: |
16314854226 |
| Email: |
info@bocsci.com |
|
| | 9BETA, 11ALPHA-PROSTAGLANDIN F2 Basic information |
| Product Name: | 9BETA, 11ALPHA-PROSTAGLANDIN F2 | | Synonyms: | 9BETA,11ALPHA-PGF2;9BETA, 11ALPHA-PROSTAGLANDIN F2;9BETA-PGF2ALPHA;9BETA,11ALPHA,15S-TRIHYDROXY-PROSTA-5Z,13E-DIEN-1-OIC ACID;PROSTAGLANDIN F2BETA;7-(3,5-dihydroxy-2-(3-hydroxy-1-octenyl)cyclopentyl)-5-heptenoicacistereo;PXGPLTODNUVGFL-JZFBHDEDSA-N;Prostaglandin F2 MaxSpecStandard | | CAS: | 4510-16-1 | | MF: | C20H34O5 | | MW: | 354.48 | | EINECS: | | | Product Categories: | | | Mol File: | 4510-16-1.mol |  |
| | 9BETA, 11ALPHA-PROSTAGLANDIN F2 Chemical Properties |
| storage temp. | Store at -20°C | | solubility | DMF: >100 mg/ml,DMSO: >100 mg/ml,Ethanol: >100 mg/ml,PBS pH 7.2: 10 mg/ml | | form | powder | | InChIKey | PXGPLTODNUVGFL-JZFBHDEDSA-N | | SMILES | O[C@@H]1C[C@@H](O)[C@H](C/C=C\CCCC(O)=O)[C@H]1/C=C/[C@@H](O)CCCCC |
| WGK Germany | WGK 1 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Oral
Repr. 1B |
| | 9BETA, 11ALPHA-PROSTAGLANDIN F2 Usage And Synthesis |
| Uses | 9beta,11alpha-Prostaglandin F2 is the C-9 epimer of PGF2α, a bronchodilator that exhibits negative chronotopic activity. | | Definition | ChEBI: Prostaglandin F2beta is a prostaglandins Falpha that is prosta-5,13-dien-1-oic acid substituted by hydroxy groups at positions 9, 11 and 15. It is the 9beta-hydroxy epimer of prostaglandin F2alpha. It has a role as a human metabolite. It is a conjugate acid of a prostaglandin F2beta(1-). |
| | 9BETA, 11ALPHA-PROSTAGLANDIN F2 Preparation Products And Raw materials |
|