| Company Name: |
BOC Sciences |
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
LYC-55716 manufacturers
- Cintirorgon
-
- $64.00
-
2026-07-17
- CAS:2055536-64-4
- Purity: 99.92%
- Supply Ability: 10g
|
| | LYC-55716 Basic information |
| Product Name: | LYC-55716 | | Synonyms: | LYC-55716;(S)-3-(6-(3-(difluoromethoxy)-5-fluorophenyl)-4-((3-(trifluoromethyl)phenyl)sulfonyl)-3,4-dihydro-2H-benzo[b][1,4]oxazin-2-yl)-2,2-dimethylpropanoic acid;Cintirorgon);LYC-55716
(LYC55716;2H-1,4-Benzoxazine-2-propanoic acid, 6-[3-(difluoromethoxy)-5-fluorophenyl]-3,4-dihydro-α,α-dimethyl-4-[[3-(trifluoromethyl)phenyl]sulfonyl]-, (2S)-;Cintirorgon (LYC-55716);9-hydroxy-3-isobutyl-10-methoxy-3,4,6,7-tetrahydro-1H-pyrido[2,1-a]isoquinolin-2(11bH)-one;Cintirorgon（ LYC-557160 | | CAS: | 2055536-64-4 | | MF: | C27H23F6NO6S | | MW: | 603.53 | | EINECS: | | | Product Categories: | | | Mol File: | 2055536-64-4.mol |  |
| | LYC-55716 Chemical Properties |
| Boiling point | 669.1±65.0 °C(Predicted) | | density | 1.417±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 100 mg/ml | | form | A crystalline solid | | pka | 4.68±0.10(Predicted) | | color | White to off-white | | InChIKey | GULSIMHVQYBADX-XKGZFIRZNA-N | | SMILES | S(C1C=CC=C(C(F)(F)F)C=1)(N1C[C@H](CC(C)(C)C(=O)O)OC2=CC=C(C3C=C(F)C=C(OC(F)F)C=3)C=C12)(=O)=O |&1:13,r| |
| | LYC-55716 Usage And Synthesis |
| Uses | Cintirorgon (LYC-55716) is a first-in-class, selective and orally bioavailable RORγ agonist. Cintirorgon (LYC-55716) modulates gene expression of RORγ expressing T lymphocyte immune cells, resulting in enhanced effector function, as well as decreased immunosuppression, resulting in decreased tumor growth, and improved survival[1][2]. | | in vivo | Upon oral administration of RORγ agonist Cintirorgon (LYC-55716), this agent selectively binds to the nuclear receptor transcription factor RORγ, forming a receptor complex that translocates to the nucleus, and binds to ROR response elements (ROREs), enhancing the function, proliferation and survival of type 17 T cells, including Th17 (helper T cells) and Tc17 (cytotoxic T cells). RORγ, the nuclear receptor transcription factor that is involved in Th17/Tc17 differentiation, plays a key role in immune activation. Cintirorgon (LYC-55716) is also orally bioavailable, while the new generation of immuno-oncology drugs-ncluding PD-1/PD-L1 inhibitors are delivered by injection[1]. | | References | [1] Lycera Announces Initiation of Phase 1/2a Study ARGON of Immuno-Oncology Candidate LYC-55716 in Patients with Advanced Solid Tumors. Jan 04, 2017. |
| | LYC-55716 Preparation Products And Raw materials |
|