Cintirorgon sodium manufacturers
|
| | Cintirorgon sodium Basic information |
| Product Name: | Cintirorgon sodium | | Synonyms: | Cintirorgon sodium;CINTIRORGON SODIUM;LYC 55716;LYC-55716;LYC55716;3-[(2S)-6-[3-(difluoromethoxy)-5-fluorophenyl]-4-[3-(trifluoromethyl)phenyl]sulfonyl-2,3-dihydro-1,4-benzoxazin-2-yl]-2,2-dimethylpropanoate;LYC-55716 sodium salt | | CAS: | 2055538-47-9 | | MF: | C27H24F6NNaO6S | | MW: | 627.53 | | EINECS: | | | Product Categories: | | | Mol File: | 2055538-47-9.mol |  |
| | Cintirorgon sodium Chemical Properties |
| InChIKey | ACMDENFXDMXUTR-BYMHURCTNA-N | | SMILES | S(C1C=CC=C(C(F)(F)F)C=1)(N1C[C@H](CC(C)(C)C(=O)O)OC2=CC=C(C3C=C(F)C=C(OC(F)F)C=3)C=C12)(=O)=O.[NaH] |&1:13,r| |
| | Cintirorgon sodium Usage And Synthesis |
| Uses | Cintirorgon sodium is a first-in-class, selective and orally bioavailable RORγ agonist. Cintirorgon sodium (LYC-55716) modulates gene expression of RORγ expressing T lymphocyte immune cells, resulting in enhanced effector function, as well as decreased immunosuppression, resulting in decreased tumor growth, and improved survival[1][2]. | | References | [1] Lycera Announces Initiation of Phase 1/2a Study ARGON of Immuno-Oncology Candidate LYC-55716 in Patients with Advanced Solid Tumors. Jan 04, 2017. |
| | Cintirorgon sodium Preparation Products And Raw materials |
|