| Company Name: |
Rhawn Reagent |
| Tel: |
400-400-1332688 18019345275 |
| Email: |
huyue@rhawn.cn |
|
| | 2,5-Dioxo-1-pyrrolidinyl 4-(1,2,2-triphenylethenyl)benzoate Basic information |
| Product Name: | 2,5-Dioxo-1-pyrrolidinyl 4-(1,2,2-triphenylethenyl)benzoate | | Synonyms: | 2,5-Dioxo-1-pyrrolidinyl 4-(1,2,2-triphenylethenyl)benzoate;2,5-Dioxopyrrolidin-1-yl 4-(1,2,2-triphenylvinyl)benzoate;Benzoic acid, 4-(1,2,2-triphenylethenyl)-, 2,5-dioxo-1-pyrrolidinyl ester;TPE-NHS | | CAS: | 2001537-57-9 | | MF: | C31H23NO4 | | MW: | 473.52 | | EINECS: | | | Product Categories: | | | Mol File: | 2001537-57-9.mol |  |
| | 2,5-Dioxo-1-pyrrolidinyl 4-(1,2,2-triphenylethenyl)benzoate Chemical Properties |
| Boiling point | 581.2±60.0 °C(Predicted) | | density | 1.31±0.1 g/cm3(Predicted) | | storage temp. | Storage temp. -20°C | | Appearance | White to off-white Solid | | InChI | InChI=1S/C31H23NO4/c33-27-20-21-28(34)32(27)36-31(35)26-18-16-25(17-19-26)30(24-14-8-3-9-15-24)29(22-10-4-1-5-11-22)23-12-6-2-7-13-23/h1-19H,20-21H2 | | InChIKey | AFMHDDYZINMVBF-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)C1=CC=C(/C(/C2=CC=CC=C2)=C(\C2=CC=CC=C2)/C2=CC=CC=C2)C=C1 |
| | 2,5-Dioxo-1-pyrrolidinyl 4-(1,2,2-triphenylethenyl)benzoate Usage And Synthesis |
| | 2,5-Dioxo-1-pyrrolidinyl 4-(1,2,2-triphenylethenyl)benzoate Preparation Products And Raw materials |
|