1-methyl-4-(1,2,2-triphenylethenyl)benzene manufacturers
|
| | 1-methyl-4-(1,2,2-triphenylethenyl)benzene Basic information | | Application |
| Product Name: | 1-methyl-4-(1,2,2-triphenylethenyl)benzene | | Synonyms: | 1-methyl-4-(1,2,2-triphenylethenyl)benzene;(2-(P-tolyl)ethene-1,1,2-triyl)tribenzene;Benzene, 1-methyl-4-(1,2,2-triphenylethenyl)-;1-(4-methylphenyl)-1,2,2-triphenylethylene;1-methyl-4-(1,2,2- 2-triphenylethenyl)benzene | | CAS: | 70592-06-2 | | MF: | C27H22 | | MW: | 346.46 | | EINECS: | | | Product Categories: | | | Mol File: | 70592-06-2.mol |  |
| | 1-methyl-4-(1,2,2-triphenylethenyl)benzene Chemical Properties |
| Melting point | 150-151 °C | | Boiling point | 436.0±40.0 °C(Predicted) | | density | 1.076±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | Appearance | White to off-white Solid | | InChI | InChI=1S/C27H22/c1-21-17-19-25(20-18-21)27(24-15-9-4-10-16-24)26(22-11-5-2-6-12-22)23-13-7-3-8-14-23/h2-20H,1H3 | | InChIKey | CNZZQDOFHHSVMJ-UHFFFAOYSA-N | | SMILES | C1(C)=CC=C(/C(/C2=CC=CC=C2)=C(\C2=CC=CC=C2)/C2=CC=CC=C2)C=C1 |
| | 1-methyl-4-(1,2,2-triphenylethenyl)benzene Usage And Synthesis |
| Application | 1-(4-Methylphenyl)-1,2,2-triphenylene can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production processes. |
| | 1-methyl-4-(1,2,2-triphenylethenyl)benzene Preparation Products And Raw materials |
|