BenzeneMethanol, 4-(1,2,2-triphenylethenyl)- manufacturers
|
| | BenzeneMethanol, 4-(1,2,2-triphenylethenyl)- Basic information | | Application |
| Product Name: | BenzeneMethanol, 4-(1,2,2-triphenylethenyl)- | | Synonyms: | BenzeneMethanol, 4-(1,2,2-triphenylethenyl)-;4-(triphenylethenyl)-benzenemethanol;4-(1,2,2-triphenylethenyl)-BenzeneMethanol;BenzeneMethanol, 4-(1,2,2-triphenylethenyl)- ISO 9001:2015 REACH;(4-(1,2,2-Triphenylvinyl)phenyl)methanol - [T89598];(4-(1,2,2-triphenylvinyl)phenyl)Methanol | | CAS: | 1015082-83-3 | | MF: | C27H22O | | MW: | 362.46 | | EINECS: | | | Product Categories: | | | Mol File: | 1015082-83-3.mol |  |
| | BenzeneMethanol, 4-(1,2,2-triphenylethenyl)- Chemical Properties |
| Melting point | 105 °C | | Boiling point | 479.6±14.0 °C(Predicted) | | density | 1.134±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 14.36±0.10(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C27H22O/c28-20-21-16-18-25(19-17-21)27(24-14-8-3-9-15-24)26(22-10-4-1-5-11-22)23-12-6-2-7-13-23/h1-19,28H,20H2 | | InChIKey | YWWJSALZIIHPGD-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(/C(/C2=CC=CC=C2)=C(\C2=CC=CC=C2)/C2=CC=CC=C2)C=C1 |
| | BenzeneMethanol, 4-(1,2,2-triphenylethenyl)- Usage And Synthesis |
| Application | [1-(4-Methanolphenyl)-1,2,2-triphenyl]ethylene can be used as an organic synthesis intermediate and a pharmaceutical intermediate, mainly in laboratory research and development processes and chemical production processes. |
| | BenzeneMethanol, 4-(1,2,2-triphenylethenyl)- Preparation Products And Raw materials |
|