|
|
| | 3-tert-Butyl-1-(2-methylphenyl)-1H-pyrazol-5-amine Basic information |
| Product Name: | 3-tert-Butyl-1-(2-methylphenyl)-1H-pyrazol-5-amine | | Synonyms: | 5-tert-butyl-2-(2-methylphenyl)pyrazol-3-amine;5-TERT-BUTYL-2-O-TOLYL-2H-PYRAZOL-3-YLAMINE;3-Amino-5-tert-butyl-2-o-tolyl-2H-pyrazole;3-tert-butyl-1-o-tolyl-1H-pyrazol-5-aMine;1H-Pyrazol-5-aMine, 3-(1,1-diMethylethyl)-1-(2-Methylphenyl)-;JR-13691, 3-Tert-butyl-1-o-tolyl-1H-pyrazol-5-amine, 95%;5-tert-butyl-2-(2-methylphenyl)-3-pyrazolamine;3-(1,1-Dimethylethyl)-1-(2-methylphenyl)-1H-pyrazol-5-amine | | CAS: | 337533-96-7 | | MF: | C14H19N3 | | MW: | 229.32 | | EINECS: | | | Product Categories: | | | Mol File: | 337533-96-7.mol |  |
| | 3-tert-Butyl-1-(2-methylphenyl)-1H-pyrazol-5-amine Chemical Properties |
| Boiling point | 377.5±30.0 °C(Predicted) | | density | 1.06±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | form | solid | | pka | 4.05±0.10(Predicted) | | InChI | 1S/C14H19N3/c1-10-7-5-6-8-11(10)17-13(15)9-12(16-17)14(2,3)4/h5-9H,15H2,1-4H3 | | InChIKey | SNMGAKOWUHTEKD-UHFFFAOYSA-N | | SMILES | Cc1ccccc1-n2nc(cc2N)C(C)(C)C |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 |
| | 3-tert-Butyl-1-(2-methylphenyl)-1H-pyrazol-5-amine Usage And Synthesis |
| | 3-tert-Butyl-1-(2-methylphenyl)-1H-pyrazol-5-amine Preparation Products And Raw materials |
|