|
|
| | N3-cyclopropyl-7-[[4-(1-methylethyl)phenyl]methyl]-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine dihydrochloride Basic information |
| Product Name: | N3-cyclopropyl-7-[[4-(1-methylethyl)phenyl]methyl]-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine dihydrochloride | | Synonyms: | SCH 79797 DIHYDROCHLORIDE;N3-Cyclopropyl-7-[[4-(1-methylethyl)phenyl]methyl]-7H-pyrrolo[3,2-f]quinazoline-1,3-diaminedihydrochloride;SCH797972HCl;N3-Cyclopropyl-7-(4-isopropylbenzyl)-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine;7H-Pyrrolo[3,2-f]quinazoline-1,3-diamine,N3-cyclopropyl-7-[[4-(1-methylethyl)phenyl]methyl]-;3-N-cyclopropyl-7-[(4-propan-2-ylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine;SCH 79797 dihydrochl;Sch 79797 | | CAS: | 245520-69-8 | | MF: | C23H25N5 | | MW: | 371.48 | | EINECS: | | | Product Categories: | Non-Chiral heterocyclic compounds;Pharmaceuticals;Proteinase-activated receptor (PAR) | | Mol File: | 245520-69-8.mol | ![N3-cyclopropyl-7-[[4-(1-methylethyl)phenyl]methyl]-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine dihydrochloride Structure](CAS/GIF/245520-69-8.gif) |
| | N3-cyclopropyl-7-[[4-(1-methylethyl)phenyl]methyl]-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine dihydrochloride Chemical Properties |
| Boiling point | 644.4±65.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | Desiccate at RT | | solubility | DMSO : 50 mg/mL (134.60 mM; Need ultrasonic) | | pka | 8.73±0.40(Predicted) | | form | Solid | | color | Light yellow to brown | | InChIKey | NNJTXSQXGHYXAJ-UHFFFAOYSA-N | | SMILES | Cl.Cl.[n]2(c3c(c4c(nc(nc4N)NC5CC5)cc3)cc2)Cc1ccc(cc1)C(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | N3-cyclopropyl-7-[[4-(1-methylethyl)phenyl]methyl]-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine dihydrochloride Usage And Synthesis |
| Uses | SCH 79797 Dihydrochloride is a selective PAR1 antagonist. | | Definition | ChEBI: N3-cyclopropyl-7-[(4-propan-2-ylphenyl)methyl]pyrrolo[3,2-f]quinazoline-1,3-diamine is a member of quinazolines. | | Biological Activity | Potent, selective non-peptide PAR 1 receptor antagonist (IC 50 = 70 nM). Inhibits haTRAP-induced- but not g-thrombin-, ADP- or collagen-induced human platelet aggregation. Also selectively blocks PAR 1 agonist- or thrombin-induced increases in cytosolic Ca 2+ in vascular smooth muscle cells. | | in vivo | SCH79797 (2.5-250 μg/kg; intravenous injection; male Sprague Dawley rats) treatment immediately before or during ischemia reduces myocardial necrosis following I/R in the intact rat heart in two rat models of myocardial ischemia/reperfusion (I/R) injury. This response is dose-dependent with the optimal dose being 25 μg/kg[4]. | Animal Model: | Male Sprague Dawley rats (8 weeks of age) with myocardial I/R injury[4] | | Dosage: | 2.5 μg/kg, 10 μg/kg, 25 μg/kg, 50 μg/kg, 100 μg/kg, and 250 μg/kg | | Administration: | Intravenous injection | | Result: | Immediately before or during ischemia reduced myocardial necrosis following I/R in the intact rat heart. |
| | IC 50 | PAR1: 70 nM (IC50); PAR1: 35 nM (Ki) |
| | N3-cyclopropyl-7-[[4-(1-methylethyl)phenyl]methyl]-7H-pyrrolo[3,2-f]quinazoline-1,3-diamine dihydrochloride Preparation Products And Raw materials |
|