|
|
| | 1H,1H-Heptafluorobutyl triflate Basic information |
| Product Name: | 1H,1H-Heptafluorobutyl triflate | | Synonyms: | 2,2,3,3,4,4,4-HEPTAFLUOROBUTYL TRIFLUOROMETHANESULFONATE;2,2,3,3,4,4,4-HEPTAFLUOROBUTYL TRIFLUOROMETHANESULPHONATE;1H,1H-HEPTAFLUOROBUTYL TRIFLUOROMETHANESULFONATE;1H,1H-Heptafluorobutyl trifluoromethanesulphonate;1H,1H-Heptafluorobutyl trifluoromethanesulphonate 97%;1H,1H-Heptafluorobutyltrifluoromethanesulphonate97%;Methanesulfonic acid, 1,1,1-trifluoro-, 2,2,3,3,4,4,4-heptafluorobutyl ester;1H,1H-Heptafluorobutyl triflate | | CAS: | 6401-01-0 | | MF: | C5H2F10O3S | | MW: | 332.12 | | EINECS: | | | Product Categories: | | | Mol File: | 6401-01-0.mol |  |
| | 1H,1H-Heptafluorobutyl triflate Chemical Properties |
| Boiling point | 118-120/732mm | | density | 1.720±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | refractive index | 1.302 | | form | liquid | | color | Clear | | InChI | 1S/C5H2F10O3S/c6-2(7,3(8,9)4(10,11)12)1-18-19(16,17)5(13,14)15/h1H2 | | InChIKey | NFLLLSBGBGDVEO-UHFFFAOYSA-N | | SMILES | FC(F)(F)[S](=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)F | | EPA Substance Registry System | 1H,1H-Heptafluorobutyl triflate (6401-01-0) |
| Hazard Codes | C,T | | WGK Germany | WGK 3 | | Hazard Note | Corrosive/Toxic | | HazardClass | TOXIC, CORROSIVE | | HS Code | 2904100090 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2
very toxic hazardous materials | | Hazard Classifications | Acute Tox. 2 Inhalation
Acute Tox. 3 Oral
Eye Dam. 1
Skin Corr. 1B |
| | 1H,1H-Heptafluorobutyl triflate Usage And Synthesis |
| | 1H,1H-Heptafluorobutyl triflate Preparation Products And Raw materials |
|